My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

hexadecanoate

Image of MNXM108
Properties
MNX_IDMNXM108
formulaC16H31O2
charge-1
mass255.4167
referencechebi:7896
InChIKeyIPCSVZSSVZVIGE-UHFFFAOYSA-M
InChIInChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/p-1
SMILESCCCCCCCCCCCCCCCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of hexadecanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:hdca Hexadecanoate (n-C16:0)
chebi:14730
chebi:15756
chebi:233028
chebi:24540
chebi:24541
chebi:24542
chebi:24550
chebi:29889
chebi:35978
chebi:44952
1-Pentadecanecarboxylic acid
1-hexyldecanoic acid
16:00
C16
C16 fatty acid
C16:0
CH3-[CH2]14-COOH
Hexadecanoate
Hexadecylic acid
Hexaectylic acid
IPCSVZSSVZVIGE-UHFFFAOYSA-N
PALMITIC ACID
Palmitate
Palmitic acid
Palmitinic acid
Palmitinsaeure
Pentadecanecarboxylic acid
cetylic acid
hexadecanoic acid
hexadecoic acid
n-hexadecanoic acid
n-hexadecoic acid
palmitic acid
chebi:231736
chebi:7896
(16:0)
1-hexyldecanoate
1-pentadecanecarboxylate
CH3-[CH2]14-COO(-)
Hexadecanoic acid, ion(1-)
IPCSVZSSVZVIGE-UHFFFAOYSA-M
hexadecanoate
n-hexadecanoate
n-hexadecoate
palmitate
pentadecanecarboxylate
envipath:...f7d8bf32b1cb Hexadecanoate
hmdb:HMDB00220
hmdb:HMDB60083
Palmitic acid
hexadecanoic acid
palmitic acid
kegg:C00249
kegg:D05341
Cetylic acid
Hexadecanoate
Hexadecanoic acid
Hexadecylic acid
Palmitate
Palmitic acid
Palmitic acid (NF)
lipidmaps:LMFA01010001 C16:0
Cetylic acid
Palmitate
Palmitic acid
hexadecanoic acid
lipidmaps:LMFA01010001
n-Hexadecanoic acid
lipidmaps:LMFA01010046 Hexadecanoic acid(d3)
Palmitic acid(d3)
lipidmaps:LMFA01010046
metacyc:PALMITATE PALMITATE
hexadecanoate
hexadecanoate (n-C16:0)
hexadecanoic acid
palmitate
palmitic acid
reactome:2453691
reactome:3632881
reactome:390435
reactome:426576
reactome:5690516
reactome:76168
PALM
Palmitate
hexadecanoic acid
palmitic acid
sabiork:1990 Cetylic acid
Hexadecanoate
Hexadecanoic acid
Hexadecylic acid
Palmitate
Palmitic acid
seed:cpd00214 Cetylic acid
Hexadecanoate
Hexadecanoate (n-C16,0)
Hexadecanoic acid
Hexadecylic acid
Palmitate
Palmitic acid
hdca
slm:000000510 Palmitate
hexadecanoate
deprecated:MNXM107534
deprecated:MNXM89645