Feedback

 

L-proline

Image of MNXM114
Properties
MNX_IDMNXM114
formulaC5H9NO2
charge0
mass115.1305
referencechebi:60039
InChIKeyONIBWKKTOPOVIA-BYPYZUCNSA-N
InChIInChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1
SMILES[O-]C(=O)[C@@H]1CCC[NH2+]1

This chemical compound does not exist in my selection



Occurrences of L-proline in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:pro__L L-Proline
chebi:13154
chebi:17203
chebi:184637
chebi:21373
chebi:42067
chebi:45040
chebi:45100
chebi:45159
chebi:6286
(-)-(S)-proline
(-)-2-pyrrolidinecarboxylic acid
(-)-proline
(2S)-pyrrolidine-2-carboxylic acid
(S)-2-carboxypyrrolidine
(S)-2-pyrrolidinecarboxylic acid
(S)-pyrrolidine-2-carboxylic acid
2-Pyrrolidinecarboxylic acid
L-(-)-proline
L-Prolin
L-Proline
L-alpha-pyrrolidinecarboxylic acid
L-proline
L-pyrrolidine-2-carboxylic acid
ONIBWKKTOPOVIA-BYPYZUCNSA-N
P
PROLINE
prolina
proline
prolinum
chebi:26271 DL-Proline
Hpro
ONIBWKKTOPOVIA-UHFFFAOYSA-N
Prolin
prolina
proline
pyrrolidine-2-carboxylic acid
chebi:32862 (2S)-pyrrolidine-2-carboxylate
L-prolinate
L-proline anion
ONIBWKKTOPOVIA-BYPYZUCNSA-M
chebi:32864 (2S)-2-carboxypyrrolidinium
L-proline cation
L-prolinium
ONIBWKKTOPOVIA-BYPYZUCNSA-O
chebi:32871 ONIBWKKTOPOVIA-UHFFFAOYSA-M
pro(-)
prolinate
proline anion
pyrrolidine-2-carboxylate
chebi:32872 2-carboxypyrrolidinium
H2pro(+)
ONIBWKKTOPOVIA-UHFFFAOYSA-O
proline cation
prolinium
chebi:58054
chebi:60039
(2S)-pyrrolidinium-2-carboxylate
L-proline
L-proline zwitterion
ONIBWKKTOPOVIA-BYPYZUCNSA-N
hmdb:HMDB00162 (2S)-pyrrolidine-2-carboxylic acid
L-Proline
L-proline
kegg:C16435
sabiork:25536
Proline
kegg:C00148
kegg:D00035
2-Pyrrolidinecarboxylic acid
L-Proline
L-Proline (JP17)
Proline (USP)
metacyc:PRO 2-pyrrolidinecarboxylic acid
L-pro
L-proline
P
PRO
pro
prol
proline
reactome:113538
reactome:352033
reactome:379717
2-Pyrrolidinecarboxylic acid
L-Pro
L-proline
L-proline zwitterion
sabiork:82 2-Pyrrolidinecarboxylic acid
L-Proline
Pro
seed:cpd00129 2-Pyrrolidinecarboxylic acid
L-Proline
pro-L
seed:cpd15140 Proline
cll_484
deprecated:MNXM12756
deprecated:MNXM89766
deprecated:MNXM92612
deprecated:MNXM96442