Feedback

 

citrate

Image of MNXM131
Properties
MNX_IDMNXM131
formulaC6H5O7
charge-3
mass189.1013
referencechebi:16947
InChIKeyKRKNYBCHXYNGOX-UHFFFAOYSA-K
InChIInChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/p-3
SMILESOC(CC([O-])=O)(CC([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of citrate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:cit Citrate
chebi:132362 2-oxido-1,2,3-propanetricarboxylate
2-oxidopropane-1,2,3-tricarboxylate
KSXLKRAZYZIYCZ-UHFFFAOYSA-K
citrate(4-)
citric acid tetraanion
chebi:133748 citrate
citrate anion
citrate anions
chebi:23322
chebi:30769
chebi:3727
chebi:41523
2-Hydroxy-1,2,3-propanetricarboxylic acid
2-Hydroxytricarballylic acid
2-hydroxypropane-1,2,3-tricarboxylic acid
3-Carboxy-3-hydroxypentane-1,5-dioic acid
CITRIC ACID
Citric acid
Citronensaeure
E330
H3cit
KRKNYBCHXYNGOX-UHFFFAOYSA-N
citric acid
chebi:35802 3-carboxy-2-(carboxymethyl)-2-hydroxypropanoate
KRKNYBCHXYNGOX-UHFFFAOYSA-M
chebi:35804 H2cit
H2cit(-)
citrate(1-)
dihydrogen citrate
chebi:35806 3,4-dicarboxy-3-hydroxybutanoate
KRKNYBCHXYNGOX-UHFFFAOYSA-M
chebi:35808 Hcit
Hcit(2-)
citrate(2-)
hydrogen citrate
chebi:35809 2-(carboxymethyl)-2-hydroxybutanedioate
2-(carboxymethyl)-2-hydroxysuccinate
KRKNYBCHXYNGOX-UHFFFAOYSA-L
chebi:35810 3-carboxy-3-hydroxypentanedioate
KRKNYBCHXYNGOX-UHFFFAOYSA-L
chebi:13999
chebi:16947
chebi:23321
chebi:42563
2-hydroxy-1,2,3-propanetricarboxylate
2-hydroxy-1,2,3-propanetricarboxylate(3-)
2-hydroxy-1,2,3-propanetricarboxylic acid, ion(3-)
2-hydroxypropane-1,2,3-tricarboxylate
2-hydroxytricarballylate
CITRATE ANION
KRKNYBCHXYNGOX-UHFFFAOYSA-K
cit
cit(3-)
citrate
citrate(3-)
chebi:76049 2-hydroxy((2)H4)propane-1,2,3-tricarboxylic acid
KRKNYBCHXYNGOX-LNLMKGTHSA-N
citric acid-d4
chebi:79399
kegg:C13660
Piperazine citrate
hmdb:HMDB00094 2-hydroxypropane-1,2,3-tricarboxylic acid
Citric acid
citric acid
kegg:C00158
kegg:D00037
2-Hydroxy-1,2,3-propanetricarboxylic acid
2-Hydroxytricarballylic acid
Anhydrous citric acid (JP17)
Citrate
Citric acid
Citric acid anhydrous (JAN)
Citric acid, anhydrous (USP)
metacyc:CIT 2-hydroxy-1,2,3-propanetricarboxylic acid
CIT
cit
citr
citrate
citric acid
reactome:29654 2-Hydroxy-1,2,3-propanetricarboxylic acid
2-Hydroxytricarballylic acid
CIT
Citrate
citric acid
reactome:433138
reactome:76190
CIT
Citrate
citric acid
sabiork:1952 2-Hydroxy-1,2,3-propanetricarboxylic acid
2-Hydroxytricarballylic acid
Citrate
Citric acid
seed:cpd00137 2-Hydroxy-1,2,3-propanetricarboxylic acid
2-Hydroxytricarballylic acid
Citrate
Citric acid
cit
deprecated:MNXM129712
deprecated:MNXM145530
deprecated:MNXM160257
deprecated:MNXM47046
deprecated:MNXM47047
deprecated:MNXM96431