Feedback

 

(5Z,8Z,11Z,14Z)-eicosatetraenoate

Image of MNXM135
Properties
MNX_IDMNXM135
formulaC20H31O2
charge-1
mass303.4595
referencechebi:32395
InChIKeyYZXBAPSDXZZRGB-DOFZRALJSA-M
InChIInChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22)/p-1/b7-6-,10-9-,13-12-,16-15-
SMILESCCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of (5Z,8Z,11Z,14Z)-eicosatetraenoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:13852
chebi:22607
chebi:32395
(20:4n6)
(5Z,8Z,11Z,14Z)-eicosatetraenoate
(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate
YZXBAPSDXZZRGB-DOFZRALJSA-M
arachidonate
chebi:15843
chebi:22608
chebi:2799
chebi:40501
(5Z,8Z,11Z,14Z)-5,8,11,14-icosatetraenoic acid
(5Z,8Z,11Z,14Z)-Icosatetraenoic acid
(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid
AA
ARA
ARACHIDONIC ACID
Arachidonate
Arachidonic acid
Arachidonsaeure
YZXBAPSDXZZRGB-DOFZRALJSA-N
all-cis-5,8,11,14-eicosatetraenoic acid
arachidonic acid
cis-5,8,11,14-Eicosatetraenoic acid
cis-Delta(5,8,11,14)-eicosatetraenoic acid
hmdb:HMDB01043 (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid
Arachidonic acid
arachidonic acid
hmdb:HMDB60102 (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid
Arachidonate
arachidonic acid
lipidmaps:LMFA01030001 (all-Z)-5,8,11,14-Eicosatetraenoic acid
5Z,8Z,11Z,14Z-eicosatetraenoic acid
5Z,8Z,11Z,14Z-icosatetraenoic acid
AA
Arachidonate
Arachidonic acid
all-cis-5,8,11,14-Eicosatetraenoic acid
cis-5,8,11,14-Eicosatetraenoic acid
lipidmaps:LMFA01030001
lipidmaps:LMFA01030003 5Z,8Z,11Z,14Z-eicosatetraenoic acid (5,6,8,9,11,12,14,15-d8)
Arachidonic Acid (d8)
lipidmaps:LMFA01030003
metacyc:ARACHIDONIC_ACID (5Z,8Z,11Z,14Z)-icosatetra-5,8,11,14-enoate
(5Z,8Z,11Z,14Z)-icosatetraenoate
ARACHIDONIC_ACID
all-cis-icosa-5,8,11,14-tetraenoate
arachidonate
arachidonic acid
sabiork:1980 Arachidonate
Arachidonic acid
cis-5,8,11,14-Eicosatetraenoic acid
kegg:C00219
seed:cpd00188
(5Z,8Z,11Z,14Z)-Icosatetraenoic acid
Arachidonate
Arachidonic acid
cis-5,8,11,14-Eicosatetraenoic acid
slm:000000296 (5Z,8Z,11Z,14Z)-eicosatetraenoate
20:4(5Z,8Z,11Z,14Z)
Arachidonate
deprecated:MNXM102791