My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

D-threo-isocitrate

Image of MNXM162
Properties
MNX_IDMNXM162
formulaC6H5O7
charge-3
mass189.1013
referencechebi:15562
InChIKeyODBLHEXUDAPZAU-ZAFYKAAXSA-K
InChIInChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/p-3/t2-,4+/m0/s1
SMILESO[C@H]([C@H](CC([O-])=O)C([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of D-threo-isocitrate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:10827
chebi:15562
chebi:18510
(1R,2S)-1-hydroxypropane-1,2,3-tricarboxylate
D-threo-isocitrate
D-threo-isocitrate(3-)
ODBLHEXUDAPZAU-ZAFYKAAXSA-K
threo-Ds-isocitrate
chebi:151 (+)-threo-isocitric acid
(1R,2S)-1-hydroxypropane-1,2,3-tricarboxylic acid
3-carboxy-2,3-dideoxy-L-threo-pentaric acid
D-threo-Isocitric acid
D-threo-isocitric acid
ISOCITRIC ACID
ODBLHEXUDAPZAU-ZAFYKAAXSA-N
hmdb:HMDB01874 (1R,2S)-1-hydroxypropane-1,2,3-tricarboxylic acid
D-threo-Isocitric acid
threo-DS(+)-isocitrate
kegg:C00451
seed:cpd00353
(1R,2S)-1-Hydroxypropane-1,2,3-tricarboxylate
D-threo-Isocitric acid
metacyc:THREO-DS-ISO-CITRATE (1R, 2S)-1-hydroxypropane-1,2,3-tricarboxylate
D-isocitrate
D-threo-isocitrate
D-threo-isocitric acid
I-CIT
THREO-DS-ISO-CITRATE
isocitrate
isocitric acid
threo-Ds-isocitrate
reactome:29938
reactome:389545
reactome:389548
(1R,2S)-1-Hydroxypropane-1,2,3-tricarboxylate
1-Hydroxypropane-1,2,3-tricarboxylic acid
1-Hydroxytricarballylic acid
D-erythro-Isocitric acid
D-threo-isocitric acid
ISCIT
Isocitrate
Isocitric acid
deprecated:MNXM89640