Feedback

 

L-glutamate

MNXM18 is deprecated and replaced by MNXM89557
Image of MNXM89557
Properties
MNX_IDMNXM89557
formulaC5H8NO4
charge-1
mass146.1219
referencechebi:29985
InChIKeyWHUUTDBJXJRKMK-VKHMYHEASA-M
InChIInChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-1/t3-/m0/s1
SMILES[NH3+][C@@H](CCC([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of L-glutamate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:glu__L L-Glutamate
chebi:13107
chebi:21301
chebi:29985
(2S)-2-ammoniopentanedioate
L-glutamate
L-glutamate(1-)
L-glutamic acid monoanion
L-glutamic acid, ion(1-)
WHUUTDBJXJRKMK-VKHMYHEASA-M
hydrogen L-glutamate
chebi:14321 2-ammoniopentanedioate
WHUUTDBJXJRKMK-UHFFFAOYSA-M
glutamate
glutamate(1-)
glutamic acid monoanion
hydrogen glutamate
chebi:18237
chebi:24314
chebi:5431
2-Aminoglutaric acid
2-aminopentanedioic acid
DL-Glutamic acid
DL-Glutaminic acid
E
Glu
Glutamate
Glutamic acid
Glutaminic acid
Glutaminsaeure
WHUUTDBJXJRKMK-UHFFFAOYSA-N
glutamic acid
chebi:29987 2-aminopentanedioate
WHUUTDBJXJRKMK-UHFFFAOYSA-L
glutamate
glutamate(2-)
glutamic acid dianion
chebi:29988 (2S)-2-aminopentanedioate
L-glutamate
L-glutamate(2-)
L-glutamic acid dianion
WHUUTDBJXJRKMK-VKHMYHEASA-L
chebi:16015
chebi:21304
chebi:42825
chebi:6224
(2S)-2-aminopentanedioic acid
(S)-2-aminopentanedioic acid
(S)-glutamic acid
E
GLUTAMIC ACID
Glu
Glutamate
L-Glu
L-Glutamic acid
L-Glutaminic acid
L-Glutaminsaeure
L-glutamic acid
WHUUTDBJXJRKMK-VKHMYHEASA-N
acide glutamique
acido glutamico
acidum glutamicum
glutamic acid
chebi:76051 (2,3,3,4,4-(2)H5)glutamic acid
2,3,3,4,4-pentadeuterioglutamic acid
WHUUTDBJXJRKMK-UXXIZXEISA-N
glutamic acid-2,3,3,4,4-d5
glutamic acid-d5
hmdb:HMDB00148 (2S)-2-aminopentanedioic acid
L-Glutamic acid
L-glutamic acid
hmdb:HMDB60475 2-aminopentanedioic acid
DL-Glutamate
DL-glutamic acid
kegg:C00025
kegg:D00007
Glutamate
Glutamic acid (USP)
L-Glutamate
L-Glutamic acid
L-Glutamic acid (JP17)
L-Glutaminic acid
kegg:C00302
kegg:D04341
2-Aminoglutaric acid
DL-Glutamic acid
Glutamate
Glutamic acid (USAN)
Glutaminic acid
metacyc:GLT 1-amino-propane-1,3-dicarboxylic acid
2-aminopentanedioic acid
E
GLT
L-glu
L-glutamate
L-glutamic acid
alpha-aminoglutaric acid
glt
glu
glut
glutacid
glutaminic acid
metacyc:Glutamates Glutamates
a glutamate
reactome:113552 Glu
L-Glu
L-Glutamate
L-Glutaminic acid
L-glutamate(1-)
L-glutamic acid
reactome:210382
reactome:29404
reactome:428614
L-Glu
L-Glutamate
L-Glutaminic acid
L-glutamate(1-)
L-glutamic acid
sabiork:2010 2-Aminoglutaric acid
Glutamate
Glutaminic acid
sabiork:73 Glu
L-Glutamate
L-Glutamic acid
L-Glutaminic acid
seed:cpd00023 2-Aminoglutaric acid
DL-Glutamate
DL-Glutaminic acid
GLU
Glutamate
Glutaminic acid
L-Glutamate
L-Glutamic acid
L-Glutaminic acid
glu-L
seed:cpd19002 2-Aminoglutaric acid
DL-Glutamate
DL-Glutaminic acid
Glutamic acid
seed:cpd27177 Glutamates
deprecated:MNXM18
deprecated:MNXM96412