Feedback

 

L-valine

Image of MNXM199
Properties
MNX_IDMNXM199
formulaC5H11NO2
charge0
mass117.1463
referencechebi:57762
InChIKeyKZSNJWFQEVHDMF-BYPYZUCNSA-N
InChIInChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1
SMILESCC(C)[C@H]([NH3+])C([O-])=O

This chemical compound does not exist in my selection



Occurrences of L-valine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:val__L
envipath:...ac1a3c2159c5
L-Valine
chebi:13186
chebi:16414
chebi:21417
chebi:46282
chebi:46376
chebi:46418
chebi:46484
chebi:6321
(2S)-2-amino-3-methylbutanoic acid
(S)-valine
2-Amino-3-methylbutyric acid
KZSNJWFQEVHDMF-BYPYZUCNSA-N
L-(+)-alpha-Aminoisovaleric acid
L-Valin
L-Valine
L-alpha-Amino-beta-methylbutyric acid
L-valine
V
VALINE
Val
chebi:27266 2-amino-3-methylbutanoic acid
DL-valine
Hval
KZSNJWFQEVHDMF-UHFFFAOYSA-N
Valin
valina
valine
chebi:32851 (2S)-2-amino-3-methylbutanoate
KZSNJWFQEVHDMF-BYPYZUCNSA-M
L-valinate
L-valine anion
chebi:32852 (1S)-1-carboxy-2-methylpropan-1-aminium
KZSNJWFQEVHDMF-BYPYZUCNSA-O
L-valine cation
L-valinium
chebi:32859 2-amino-3-methylbutanoate
KZSNJWFQEVHDMF-UHFFFAOYSA-M
val(-)
valinate
valine anion
chebi:32860 1-carboxy-2-methylpropan-1-aminium
H2val(+)
KZSNJWFQEVHDMF-UHFFFAOYSA-O
valine cation
valinium
chebi:57762 (2S)-2-ammonio-3-methylbutanoate
(2S)-2-azaniumyl-3-methylbutanoate
KZSNJWFQEVHDMF-BYPYZUCNSA-N
L-valine
L-valine zwitterion
chebi:87977 ((13)C5,(15)N)-valine
KZSNJWFQEVHDMF-XAFSXMPTSA-N
L-((13)C5,(15)N)valine
envipath:...007eb0537f0e compound 38807
hmdb:HMDB00883
hmdb:HMDB34366
(2S)-2-amino-3-methylbutanoic acid
L-Valine
L-valine
kegg:C00183
kegg:D00039
2-Amino-3-methylbutyric acid
L-Valine
L-Valine (JP17)
Valine (USP)
lipidmaps:LMFA01100046 2-Amino-3-methylbutanoic acid
lipidmaps:LMFA01100046
metacyc:VAL L-val
L-valine
V
VAL
val
valine
reactome:113540
reactome:29702
2-Amino-3-methylbutyric acid
L-Val
L-valine
L-valine zwitterion
kegg:C16436
sabiork:23113
Valine
sabiork:68 2-Amino-3-methylbutyric acid
L-Valine
Val
seed:cpd00156 2-Amino-3-methylbutyric acid
L-Valine
val-L
seed:cpd15141 Valine
cll_96
deprecated:MNXM13250
deprecated:MNXM96489