My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

3,4-dihydroxybenzoate

Image of MNXM204
Properties
MNX_IDMNXM204
formulaC7H5O4
charge-1
mass153.1127
referencechebi:36241
InChIKeyYQUVCSBJEUQKSH-UHFFFAOYSA-M
InChIInChI=1S/C7H6O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H,(H,10,11)/p-1
SMILESOc1ccc(cc1O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 3,4-dihydroxybenzoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:11694
chebi:14955
chebi:19878
chebi:36241
3,4-Dihydroxybenzoate
3,4-dihydroxybenzoate
4,5-dihydroxybenzoate
YQUVCSBJEUQKSH-UHFFFAOYSA-M
chebi:1380
chebi:16798
chebi:19879
chebi:20270
chebi:20272
chebi:36062
chebi:41912
3,4-Dihydroxybenzoic acid
3,4-dihydroxybenzoic acid
4,5-Dihydroxybenzoic acid
4-Carboxy-1,2-dihydroxybenzene
Protocatechuic acid
Protocatehuic acid
YQUVCSBJEUQKSH-UHFFFAOYSA-N
bigg:34dhbz
envipath:...efc74746beaf
3,4-Dihydroxybenzoate
envipath:...74b58dbfbcfc compound 136
envipath:...f0aeebfeec63 compound 37917
hmdb:HMDB01856 3,4-dihydroxybenzoic acid
Protocatechuic acid
kegg:C00230
sabiork:1983
3,4-Dihydroxybenzoate
3,4-Dihydroxybenzoic acid
Protocatechuate
Protocatechuic acid
metacyc:3-4-DIHYDROXYBENZOATE 3,4-DHBA
3,4-dihydrobenzoic acid
3,4-dihydroxybenzoate
3,4-dihydroxybenzoic acid
3-4-DIHYDROXYBENZOATE
4,5-dihydroxybenzoic acid
4-carboxy-1,2-dihydroxybenzene
Pca
benzoic acid, 3,4-dihydroxy-
catechol-4-carboxylic acid
protocatechuate
protocatechuic acid
protocatehuic acid
reactome:175977 3,4-dihydroxybenzoate
3,4-dihydroxybenzoic acid
3,4DHBNZ
protocatechuate
seed:cpd00197 3,4-Dihydroxybenzoate
3,4-Dihydroxybenzoic acid
34dhbz
Protocatechuate
Protocatechuic acid
deprecated:MNXM90391