Feedback

 

dopamine

Image of MNXM205
Properties
MNX_IDMNXM205
formulaC8H12NO2
charge1
mass154.1858
referencechebi:59905
InChIKeyVYFYYTLLBUKUHU-UHFFFAOYSA-O
InChIInChI=1S/C8H11NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,10-11H,3-4,9H2/p+1
SMILES[NH3+]CCc1ccc(O)c(O)c1

This chemical compound does not exist in my selection



Occurrences of dopamine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:dopa Dopamine
chebi:11695
chebi:11930
chebi:14203
chebi:1764
chebi:18243
chebi:23886
chebi:43686
2-(3,4-Dihydroxyphenyl)ethylamine
2-(3,4-dihydroxyphenyl)ethylamine
3,4-Dihydroxyphenethylamine
3-Hydroxytyramine
4-(2-Aminoethyl)-1,2-benzenediol
4-(2-Aminoethyl)benzene-1,2-diol
4-(2-aminoethyl)-1,2-benzenediol
4-(2-aminoethyl)benzene-1,2-diol
4-(2-aminoethyl)catechol
4-(2-aminoethyl)pyrocatechol
Deoxyepinephrine
Dopamine
Hydroxytyramin
VYFYYTLLBUKUHU-UHFFFAOYSA-N
dopamina
dopamine
dopaminum
chebi:59905 2-(3,4-dihydroxyphenyl)ethan-1-aminium
2-(3,4-dihydroxyphenyl)ethanaminium
VYFYYTLLBUKUHU-UHFFFAOYSA-O
dopamine
dopaminium cation
dopaminium(1+)
envipath:...b97abf5dc03c compound 44331
hmdb:HMDB00073 4-(2-aminoethyl)benzene-1,2-diol
Dopamine
dopamine
kegg:C03758
kegg:D07870
2-(3,4-Dihydroxyphenyl)ethylamine
3,4-Dihydroxyphenethylamine
4-(2-Aminoethyl)-1,2-benzenediol
4-(2-Aminoethyl)benzene-1,2-diol
Dopamine
Dopamine (INN)
Medopa (TN)
metacyc:DOPAMINE 2-(3,4-dihydroxyphenyl)ethylamine
3,4-dihydroxyphenethylamine
3-hydroxytyramine
4-(2-aminoethyl)benzene-1,2-diol
DOPAMINE
deoxyepinephrine
dopamine
hydroxytyramine
intropin
reactome:159362
reactome:351601
reactome:380873
DA
dopamine
sabiork:20037 3,4-Dihydroxyphenethylamine
sabiork:6836 2-(3,4-Dihydroxyphenyl)ethylamine
4-(2-Aminoethyl)-1,2-benzenediol
4-(2-Aminoethyl)benzene-1,2-diol
Dopamine
seed:cpd02357 2-(3,4-Dihydroxyphenyl)ethylamine
3,4-Dihydroxyphenethylamine
4-(2-Aminoethyl)-1,2-benzenediol
4-(2-Aminoethyl)benzene-1,2-diol
Dopamine
dopa
deprecated:MNXM89666