My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

nitrate

Image of MNXM207
Properties
MNX_IDMNXM207
formulaNO3
charge-1
mass62.0054
referencechebi:17632
InChIKeyNHNBFGGVMKEFGY-UHFFFAOYSA-N
InChIInChI=1S/NO3/c2-1(3)4/q-1
SMILES[O-][N+]([O-])=O

This chemical compound does not exist in my selection



Occurrences of nitrate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:14654
chebi:17632
chebi:44487
chebi:71263
NHNBFGGVMKEFGY-UHFFFAOYSA-N
NITRATE ION
NO3
NO3(-)
[NO3](-)
nitrate
nitrate(1-)
trioxidonitrate(1-)
trioxonitrate(1-)
trioxonitrate(V)
chebi:25545
chebi:48107
chebi:7580
GRYLNZFGIOXLOG-UHFFFAOYSA-N
HNO3
HONO2
Nitric acid
Salpetersaeure
[NO2(OH)]
acide azotique
acide nitrique
azotic acid
hydrogen nitrate
hydrogen trioxonitrate(1-)
hydroxidodioxidonitrogen
nitric acid
trioxonitric acid
bigg:no3
envipath:...04cec5197ca5
Nitrate
hmdb:HMDB01853
hmdb:HMDB02878
Nitrate
nitrate
kegg:C00244
kegg:D02313
Nitrate
Nitric acid
Nitric acid (NF)
metacyc:CPD-15028 CPD-15028
aqua fortis
nitric acid
metacyc:NITRATE NITRATE
NO3
NO3-
nitrate
sabiork:1988 Nitrate
Nitric acid
seed:cpd00209 Nitrate
Nitric acid
no3