Feedback

 

L-citrulline

Image of MNXM211
Properties
MNX_IDMNXM211
formulaC6H13N3O3
charge0
mass175.1857
referencechebi:57743
InChIKeyRHGKLRLOHDJJDR-BYPYZUCNSA-N
InChIInChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t4-/m0/s1
SMILESNC(=O)NCCC[C@H]([NH3+])C([O-])=O

This chemical compound does not exist in my selection



Occurrences of L-citrulline in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:citr__L L-Citrulline
chebi:13092
chebi:16349
chebi:21257
chebi:41489
chebi:6203
(2S)-2-amino-5-(carbamoylamino)pentanoic acid
(S)-2-Amino-5-ureidopentanoic acid
2-Amino-5-ureidovaleric acid
CITRULLINE
Cit
Citrulline
L-2-Amino-5-ureidovaleric acid
L-Citrulline
L-citrulline
N(5)-(aminocarbonyl)-L-ornithine
N(5)-carbamoyl-L-ornithine
N(delta)-carbamylornithine
N5-(Aminocarbonyl)ornithine
N5-carbamoylornithine
RHGKLRLOHDJJDR-BYPYZUCNSA-N
alpha-amino-delta-ureidovaleric acid
delta-ureidonorvaline
chebi:14002
chebi:18211
chebi:3730
2-Amino-5-uredovaleric acid
2-amino-5-(carbamoylamino)pentanoic acid
Cit
Citrullin
Citrulline
DL-2-amino-5-ureidovaleric acid
N(5)-(aminocarbonyl)-DL-ornithine
N(5)-(aminocarbonyl)ornithine
N(5)-carbamoyl-DL-ornithine
N(5)-carbamoylornithine
RHGKLRLOHDJJDR-UHFFFAOYSA-N
citrulina
citrulline
dl-citrulline
chebi:57743 (2S)-2-azaniumyl-5-(carbamoylamino)pentanoate
L-citrulline
L-citrulline zwitterion
RHGKLRLOHDJJDR-BYPYZUCNSA-N
chebi:66922 2-amino-5-(carbamoylamino)pentanoate
RHGKLRLOHDJJDR-UHFFFAOYSA-M
citrullinate
hmdb:HMDB00904 (2S)-2-amino-5-(carbamoylamino)pentanoic acid
Citrulline
L-citrulline
kegg:C00327
kegg:D07706
2-Amino-5-ureidovaleric acid
Citrulline
L-Citrulline
L-Citrulline (DCF)
metacyc:L-CITRULLINE L-CITRULLINE
L-citrulline
N5-(Aminocarbonyl)-L-ornithine
Ngamma-carbamylornithine
alpha-amino-gamma-ureidovaleric acid
gammaureidonorvaline
reactome:113567 2-Amino-5-ureidovaleric acid
L-Cit
L-citrulline
reactome:29968 2-Amino-5-ureidovaleric acid
L-Cit
L-Citrulline
sabiork:1329 2-Amino-5-ureidovaleric acid
L-Citrulline
seed:cpd00274 2-Amino-5-ureidovaleric acid
Citrulline
L-Citrulline
citr-L
deprecated:MNXM89678