Feedback

 

glycolate

Image of MNXM222
Properties
MNX_IDMNXM222
formulaC2H3O3
charge-1
mass75.044
referencechebi:29805
InChIKeyAEMRFAOFKBGASW-UHFFFAOYSA-M
InChIInChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)/p-1
SMILESOCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of glycolate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:17497
chebi:24390
chebi:42865
chebi:5475
2-Hydroxyacetic acid
2-Hydroxyethanoic acid
AEMRFAOFKBGASW-UHFFFAOYSA-N
GLYCOLIC ACID
Glycolic acid
Glycollic acid
HOCH2COOH
Hydroxyacetic acid
Hydroxyethanoic acid
alpha-Hydroxyacetic acid
alpha-hydroxyacetic acid
glycolic acid
hydroxyacetic acid
chebi:14348
chebi:24388
chebi:29805
AEMRFAOFKBGASW-UHFFFAOYSA-M
glycolate
hydroxyacetate
bigg:glyclt
envipath:...8591a6b78f5f
Glycolate
envipath:...7515166e2965 compound 680
envipath:...43ad453f2124 compound 2541
envipath:...d4ce30c862bf compound 37958
hmdb:HMDB00115
hmdb:HMDB03035
2-hydroxyacetic acid
Glycolic acid
glycolic acid
kegg:C00160
sabiork:1953
Glycolate
Glycolic acid
Hydroxyacetic acid
metacyc:GLYCOLLATE GLYCOLLATE
glycolate
glycolic acid
glycollate
hydroxyacetic acid
reactome:389822 Glycolate
glycolic acid
seed:cpd00139 Glycolate
Glycolic acid
Hydroxyacetic acid
glyclt
seed:cpd12347 omega-Hydroxy fatty acid
deprecated:MNXM89987
deprecated:MNXM91256