Feedback

 

N-acetylneuraminate

Image of MNXM227
Properties
MNX_IDMNXM227
formulaC11H18NO9
charge-1
mass308.2625
referencechebi:35418
InChIKeySQVRNKJHWKZAKO-LUWBGTNYSA-M
InChIInChI=1S/C11H19NO9/c1-4(14)12-7-5(15)2-11(20,10(18)19)21-9(7)8(17)6(16)3-13/h5-9,13,15-17,20H,2-3H2,1H3,(H,12,14)(H,18,19)/p-1/t5-,6+,7+,8+,9+,11?/m0/s1
SMILES[H][C@]1(OC(O)(C[C@H](O)[C@H]1NC(C)=O)C([O-])=O)[C@H](O)[C@H](O)CO

This chemical compound does not exist in my selection



Occurrences of N-acetylneuraminate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:acnam N-Acetylneuraminate
chebi:12471
chebi:12579
chebi:21617
chebi:33987
chebi:35418
5-acetamido-3,5-dideoxy-D-galacto-non-2-ulopyranosonate
5-acetamido-3,5-dideoxy-D-glycero-D-galacto-non-2-ulosonate
N-acetylneuraminate
SQVRNKJHWKZAKO-LUWBGTNYSA-M
sialate
chebi:17012
chebi:21620
chebi:29087
chebi:7214
5-Acetamido-3,5-dideoxy-D-glycero-D-galacto-2-nonulosonic acid
5-acetamido-3,5-dideoxy-D-glycero-D-galacto-non-2-ulopyranosonic acid
Aceneuramic acid
N-Acetylneuraminic acid
N-acetylneuraminic acid
Neu5Ac
NeuAc
O-sialic acid
SQVRNKJHWKZAKO-LUWBGTNYSA-N
aceneuramic acid
acide aceneuramique
acidium aceneuramicum
acido aceneuramico
hmdb:HMDB00230
hmdb:HMDB00800
(2S,4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid
N-Acetylneuraminic acid
beta-neu5ac
kegg:C00270 5-Acetamido-3,5-dideoxy-D-glycero-D-galacto-2-nonulosonic acid
N-Acetylneuraminate
N-Acetylneuraminic acid
Neu5Ac
metacyc:N-ACETYLNEURAMINATE 5-acetamido-3,5-dideoxy-D-glycero-D-galacto-2-nonulosonic acid
5-acetamido-3,5-dideoxy-D-glycero-D-galacto-non-2-ulopyranosonic acid
N-ACETYLNEURAMINATE
N-acetylneuraminate
N-acetylneuraminic acid
NANA
Neu5Ac
O-sialic acid
sialate
sialic acid
sabiork:2006 5-Acetamido-3,5-dideoxy-D-glycero-D-galacto-2-nonulosonic acid
N-Acetylneuraminate
N-Acetylneuraminic acid
Neu5Ac
Sialate
Sialic acid
seed:cpd00232 5-Acetamido-3,5-dideoxy-D-glycero-D-galacto-2-nonulosonic acid
N-Acetylneuraminate
N-Acetylneuraminic acid
Neu5Ac
acnam
seed:cpd27569 N-ACETYLNEURAMINATE
deprecated:MNXM97034