Feedback

 

octadecanoate

Image of MNXM236
Properties
MNX_IDMNXM236
formulaC18H35O2
charge-1
mass283.4698
referencechebi:25629
InChIKeyQIQXTHQIDYTFRH-UHFFFAOYSA-M
InChIInChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)/p-1
SMILESCCCCCCCCCCCCCCCCCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of octadecanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:ocdca Octadecanoate (n-C18:0)
chebi:231588
chebi:25629
CH3-[CH2]16-COO(-)
QIQXTHQIDYTFRH-UHFFFAOYSA-M
Stearate
octadecanoate
octadecanoic acid, ion(1-)
stearate
stearic acid, ion(1-)
chebi:25631
chebi:28842
chebi:45710
18:0
C18:0
CH3-[CH2]16-COOH
Octadecanoic acid
Octadecansaeure
Oktadekansaeure
QIQXTHQIDYTFRH-UHFFFAOYSA-N
STEARIC ACID
Stearinsaeure
acide octadecanoique
acide stearique
n-octadecanoic acid
octadecanoic acid
octadecoic acid
stearic acid
envipath:...96b6726ed216 peak 1-6 (Neudosan)
peak 4 (Neudosan)
hmdb:HMDB00827 Stearic acid
octadecanoic acid
stearic acid
kegg:C01530
kegg:D00119
Octadecanoic acid
Stearate
Stearic acid
Stearic acid (JP17/NF)
Stearic acid (TN)
lipidmaps:LMFA01010018 C18:0
Cetylacetic acid
Octadecanoate
Stearate
Stearic acid
lipidmaps:LMFA01010018
n-Octadecanoic acid
octadecanoic acid
lipidmaps:LMFA01010047 Octadecanoic acid(d3)
Stearic acid(d3)
lipidmaps:LMFA01010047
metacyc:STEARIC_ACID STEARIC_ACID
octadecanoate (n-C18:0)
octadecanoic acid
stearate
stearic acid
reactome:428198 STEA
magnesium distearate
stearate
sabiork:20032 Stearate
Stearic acid
seed:cpd01080 Octadecanoic acid
Stearate
Stearic acid
ocdca
octadecanoate
octadecanoate (n-C18,0)
slm:000000826 Stearate
octadecanoate
deprecated:MNXM109010
deprecated:MNXM65301
deprecated:MNXM89835