Feedback

 

(6S)-10-formyltetrahydrofolate

Image of MNXM237
Properties
MNX_IDMNXM237
formulaC20H21N7O7
charge-2
mass471.4245
referencechebi:57454
InChIKeyAUFGTPPARQZWDO-YPMHNXCESA-L
InChIInChI=1S/C20H23N7O7/c21-20-25-16-15(18(32)26-20)23-11(7-22-16)8-27(9-28)12-3-1-10(2-4-12)17(31)24-13(19(33)34)5-6-14(29)30/h1-4,9,11,13,23H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,22,25,26,32)/p-2/t11-,13+/m1/s1
SMILES[H]C(=O)N(C[C@H]1CNc2[nH]c(N)nc(=O)c2N1)c1ccc(cc1)C(=O)N[C@@H](CCC([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (6S)-10-formyltetrahydrofolate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:10fthf 10-Formyltetrahydrofolate
chebi:11304
chebi:15637
chebi:19108
chebi:19109
chebi:698
(6S)-10-HCO-H4folate
10-FTHF
10-Formyl-THF
10-Formyltetrahydrofolate
10-formyltetrahydrofolic acid
10-formyltetrahydropteroylglutamic acid
AUFGTPPARQZWDO-YPMHNXCESA-N
N-(10-formyl-5,6,7,8-tetrahydropteroyl)-L-glutamic acid
N-[4-(N-{[(6S)-2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}formamido)benzoyl]-L-glutamic acid
chebi:57454 (6S)-10-formyltetrahydrofolate
10-formyltetrahydrofolate dianion
10-formyltetrahydrofolate(2-)
AUFGTPPARQZWDO-YPMHNXCESA-L
N-[4-(N-{[(6S)-2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}formamido)benzoyl]-L-glutamate
hmdb:HMDB00972 (2S)-2-[(4-{N-[(2-amino-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl)methyl]formamido}phenyl)formamido]pentanedioic acid
(2S)-2-[(4-{N-[(2-amino-4-oxo-5,6,7,8-tetrahydro-1H-pteridin-6-yl)methyl]formamido}phenyl)formamido]pentanedioic acid
10-Formyltetrahydrofolate
metacyc:10-FORMYL-THF 10-FORMYL-THF
10-formyl-H4PteGlu1
10-formyl-THF mono-L-glutamate
10-formyl-tetrahydrofolate mono-L-glutamate
N10-formyl-H4F mono-L-glutamate
N10-formyl-H4PteGlu1
N10-formyl-THF mono-L-glutamate
N10-formyl-tetrahydrofolate mono-L-glutamate
reactome:419151
reactome:5389850
10-formyl-THF
10-formyltetrahydrofolate
10-formyltetrahydrofolic acid
kegg:C00234
sabiork:1318
10-Formyl-THF
10-Formyltetrahydrofolate
seed:cpd00201 10-Formyl-THF
10-Formyltetrahydrofolate
10fthf
deprecated:MNXM89824