My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

succinate

Image of MNXM25
Properties
MNX_IDMNXM25
formulaC4H4O4
charge-2
mass116.0733
referencechebi:30031
InChIKeyKDYFGRWQOYBRFD-UHFFFAOYSA-L
InChIInChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8)/p-2
SMILES[O-]C(=O)CCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of succinate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:succ
envipath:...b2ffa57fdbd7
Succinate
chebi:15125
chebi:22941
chebi:26803
chebi:30031
(-)OOC-CH2-CH2-COO(-)
KDYFGRWQOYBRFD-UHFFFAOYSA-L
butanedioate
butanedioic acid, ion(2-)
succinate
succinate(2-)
chebi:15741
chebi:22943
chebi:26807
chebi:45639
chebi:9304
1,2-ethanedicarboxylic acid
Bernsteinsaeure
Butandisaeure
Butanedionic acid
Dihydrofumaric acid
E363
Ethylenesuccinic acid
HOOC-CH2-CH2-COOH
KDYFGRWQOYBRFD-UHFFFAOYSA-N
SUCCINIC ACID
Succinic acid
acide butanedioique
acide succinique
acidum succinicum
amber acid
asuccin
butanedioic acid
spirit of amber
succinic acid
chebi:30779 3-carboxypropanoate
Butanedioic acid, conjugate base
HOOC-CH2-CH2-COO(-)
KDYFGRWQOYBRFD-UHFFFAOYSA-M
hydrogen succinate
succinate(1-)
chebi:132287
chebi:90372
((2)H4)butanedioic acid
2,2,3,3-tetradeuteriosuccinic acid
KDYFGRWQOYBRFD-LNLMKGTHSA-N
succinic acid-2,2,3,3-d4
succinic acid-d4
envipath:...de961c228496 compound 1248
envipath:...ff0f2389b693 [butanedioic acid]
envipath:...291175bd23e4 compound 39979
hmdb:HMDB00254 Succinic acid
butanedioic acid
succinic acid
lipidmaps:LMFA01170043 Butanedioic acid
Succinic acid
lipidmaps:LMFA01170043
metacyc:SUC SUC
butanedioic acid
ethylenesuccinic acid
suc
succ
succinate
succinic acid
reactome:113536
reactome:29434
reactome:389583
reactome:433123
Butanedionic acid
Ethylenesuccinic acid
SUCCA
Succinate
succinic acid
reactome:159939 SUCCA
Succinate
succinic acid
reactome:5278787 SUCCA
phys-ent-participant11066
phys-ent-participant111809
phys-ent-participant38412
phys-ent-participant38453
phys-ent-participant38560
phys-ent-participant38844
phys-ent-participant38886
phys-ent-participant38896
phys-ent-participant4531
phys-ent-participant45604
phys-ent-participant50043
phys-ent-participant50370
phys-ent-participant57044
phys-ent-participant57107
phys-ent-participant58237
phys-ent-participant58255
phys-ent-participant58273
phys-ent-participant58715
phys-ent-participant58765
phys-ent-participant6652
phys-ent-participant71719
phys-ent-participant71745
phys-ent-participant71786
phys-ent-participant71803
phys-ent-participant7255
phys-ent-participant76868
phys-ent-participant76897
phys-ent-participant77331
phys-ent-participant77408
phys-ent-participant77446
phys-ent-participant77475
phys-ent-participant77500
phys-ent-participant77528
phys-ent-participant77565
phys-ent-participant77590
phys-ent-participant77812
phys-ent-participant78825
phys-ent-participant81034
phys-ent-participant82165
phys-ent-participant83139
phys-ent-participant8547
phys-ent-participant87152
phys-ent-participant87434
phys-ent-participant88440
phys-ent-participant88510
phys-ent-participant89236
phys-ent-participant89245
phys-ent-participant89318
phys-ent-participant89599
phys-ent-participant89780
phys-ent-participant89796
phys-ent-participant89811
phys-ent-participant9052
phys-ent-participant9060
phys-ent-participant90991
phys-ent-participant91026
phys-ent-participant91038
phys-ent-participant91051
phys-ent-participant91063
phys-ent-participant91077
phys-ent-participant91497
phys-ent-participant92430
phys-ent-participant95974
phys-ent-participant97726
phys-ent-participant97741
phys-ent-participant9890
phys-ent-participant99144
phys-ent-participant99265
phys-ent-participant99375
phys-ent-participant99437
succinate
succinic acid
kegg:C00042
sabiork:1924
Butanedionic acid
Ethylenesuccinic acid
Succinate
Succinic acid
seed:cpd00036 Butanedionic acid
Ethylenesuccinic acid
Succinate
Succinic acid
succ
deprecated:MNXM89594