Feedback

 

L-dehydroascorbate

Image of MNXM250
Properties
MNX_IDMNXM250
formulaC6H5O6
charge-1
mass173.1008
referencechebi:58539
InChIKeyOESHPIGALOBJLM-REOHCLBHSA-N
InChIInChI=1S/C6H5O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,7-8H,1H2/q-1/t2-/m0/s1
SMILESOC[C@H](O)[C-]1OC(=O)C(=O)C1=O

This chemical compound does not exist in my selection



Occurrences of L-dehydroascorbate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:dhdascb Dhdascb
chebi:14108
chebi:17242
chebi:23592
chebi:4358
5-(1,2-dihydroxyethyl)furan-2,3,4(5H)-trione
Dehydroascorbate
Dehydroascorbic acid
SBJKKFFYIZUCET-UHFFFAOYSA-N
dehydroascorbates
dehydroascorbic acid
chebi:21279
chebi:21280
chebi:27956
chebi:6210
(5R)-5-[(1S)-1,2-dihydroxyethyl]furan-2,3,4(5H)-trione
DHAA
Dehydroascorbic acid
L-Dehydroascorbate
L-Dehydroascorbic acid
L-dehydroascorbic acid
L-threo-2,3-hexodiulosonic acid, gamma-lactone
L-threo-hexo-2,3-diulosono-1,4-lactone
SBJKKFFYIZUCET-JLAZNSOCSA-N
dehydro-L-ascorbic acid
dehydroascorbic acid
oxidized ascorbic acid
oxidized vitamin C
chebi:58070 2-(1,2-dihydroxyethyl)-3,4,5-trioxooxolan-2-ide
2-(1,2-dihydroxyethyl)-3,4,5-trioxotetrahydrofuran-2-ide
OESHPIGALOBJLM-UHFFFAOYSA-N
dehydroascorbic acid anion
dehydroascorbide anion
dehydroascorbide(1-)
chebi:58539 2-[(1S)-1,2-dihydroxyethyl]-3,4,5-trioxotetrahydrofuran-2-ide
L-dehydroascorbate
L-dehydroascorbate anion
L-dehydroascorbic acid(1-)
OESHPIGALOBJLM-REOHCLBHSA-N
dehydro-L-ascorbate
dehydroascorbate
hmdb:HMDB01264 (5R)-5-[(1R)-1,2-dihydroxyethyl]oxolane-2,3,4-trione
Dehydroascorbic acid
hmdb:HMDB62706 2-(1,2-dihydroxyethyl)-4,5-dioxo-4,5-dihydrofuran-3-olate
2-(1,2-dihydroxyethyl)-4,5-dioxofuran-3-olate
Dehydroascorbide(1-)
metacyc:L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE
L-dehydro-ascorbate
dehydroascorbate
reactome:198852 DHA
DHvitC
dehydroascorbate
dehydroascorbic acid
reactome:198827
reactome:351599
DHA
DHvitC
Dehydroascorbate
dehydroascorbic acid
sabiork:5086 Dehydroascorbate
Dehydroascorbic acid
sabiork:7897 L-Dehydroascorbate
L-Dehydroascorbic acid
kegg:C05422
seed:cpd00335
Dehydroascorbate
Dehydroascorbic acid
L-Dehydroascorbate
L-Dehydroascorbic acid
deprecated:MNXM114162
deprecated:MNXM48906
deprecated:MNXM89850