Feedback

 

(S)-dihydroorotate

Image of MNXM252
Properties
MNX_IDMNXM252
formulaC5H5N2O4
charge-1
mass157.1047
referencechebi:30864
InChIKeyUFIVEPVSAGBUSI-REOHCLBHSA-M
InChIInChI=1S/C5H6N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h2H,1H2,(H,9,10)(H2,6,7,8,11)/p-1/t2-/m0/s1
SMILES[O-]C(=O)[C@@H]1CC(=O)NC(=O)N1

This chemical compound does not exist in my selection



Occurrences of (S)-dihydroorotate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:dhor__S (S)-Dihydroorotate
chebi:17025
chebi:18778
chebi:417
chebi:42132
(4S)-2,6-dioxohexahydropyrimidine-4-carboxylic acid
(S)-4,5-dihydroorotic acid
(S)-dihydroorotic acid
Dihydro-L-orotic acid
L-Dihydroorotic acid
UFIVEPVSAGBUSI-REOHCLBHSA-N
chebi:11063
chebi:18777
chebi:30864
(4S)-2,6-dioxohexahydropyrimidine-4-carboxylate
(S)-4,5-dihydroorotate
(S)-dihydroorotate
4,5-dihydro-L-orotate
UFIVEPVSAGBUSI-REOHCLBHSA-M
hmdb:HMDB03349 (4S)-2,6-dioxo-1,3-diazinane-4-carboxylic acid
L-Dihydroorotic acid
L-dihydroorotic acid
kegg:C00337
sabiork:2022
(S)-4,5-Dihydroorotate
(S)-Dihydroorotate
Dihydro-L-orotic acid
L-Dihydroorotate
L-Dihydroorotic acid
metacyc:DI-H-OROTATE (S)-4,5-dihydroorotate
(S)-4,5-dihydroorotic acid
(S)-4-pyrimidinecarboxylic acid
(S)-di-H-orotate
(S)-dihydroorotate
(S)-hydroorotic acid
4,5-dihydro-L-orotate
DI-H-OROTATE
L-4,5-dihydroorotate
L-dihydroorotate
dihydro-L-orotate
reactome:76630 (S)-4,5-dihydroorotate
(S)-dihydroorotate
(S)-dihydroorotic acid
L-dihydroorotate
L-dihydroorotic acid
dihydro-L-orotic acid
seed:cpd00282 (S)-4,5-Dihydroorotate
(S)-Dihydroorotate
Dihydro-L-orotic acid
L-Dihydroorotate
L-Dihydroorotic acid
S-Dihydroorotate
dhor-S
deprecated:MNXM31218
deprecated:MNXM89844