Feedback

 

4-methylthio-2-oxobutanoate

Image of MNXM276
Properties
MNX_IDMNXM276
formulaC5H7O3S
charge-1
mass147.173
referencechebi:16723
InChIKeySXFSQZDSUWACKX-UHFFFAOYSA-M
InChIInChI=1S/C5H8O3S/c1-9-3-2-4(6)5(7)8/h2-3H2,1H3,(H,7,8)/p-1
SMILESCSCCC(=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 4-methylthio-2-oxobutanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:2kmb 2-keto-4-methylthiobutyrate
bigg:4met2obut 4-Methylthio-2-oxobutanoate
chebi:1902
chebi:22458
chebi:33574
chebi:43720
2-Keto-4-methylthiobutyric acid
2-Oxo-4-methylthiobutanoate
2-keto-4-methylthiobutyric acid
2-oxomethionine
4-(METHYLSULFANYL)-2-OXOBUTANOIC ACID
4-(methylsulfanyl)-2-oxobutanoic acid
4-Methylthio-2-oxobutanoate
4-Methylthio-2-oxobutanoic acid
4-methylthio-2-oxobutanoic acid
SXFSQZDSUWACKX-UHFFFAOYSA-N
alpha-oxo-gamma-methylthiobutyric acid
chebi:12029
chebi:16723
chebi:20451
chebi:63388
2-oxo-4-methylthiobutanoate
4-(methylsulfanyl)-2-oxobutanoate
4-methylthio-2-oxobutanoate
SXFSQZDSUWACKX-UHFFFAOYSA-M
hmdb:HMDB01553
hmdb:HMDB13210
2-Oxo-4-methylthiobutanoic acid
2-oxo-4-thiomethylbutyric acid
4-(methylsulfanyl)-2-oxobutanoic acid
kegg:C01180 2-Keto-4-methylthiobutyric acid
2-Oxo-4-methylthiobutanoate
2-Oxo-4-methylthiobutanoic acid
4-Methylthio-2-oxobutanoate
4-Methylthio-2-oxobutanoic acid
lipidmaps:LMFA01060170 2-oxo-4-methylthio-butanoic acid
4-Methylthio-2-oxobutanoic acid
lipidmaps:LMFA01060170
metacyc:CPD-479 2-keto-4-methylthiobutanoate
2-keto-4-methylthiobutyrate
2-keto-4-methylthiobutyric acid
2-keto-methyl-thio-butyrate
2-ketomethiobutyrate
2-oxo-4-methylthiobutanoic acid
2-oxomethionine
4-(methylthio)-2-oxobutanoate
4-methylthio-2-ketobutanoate
4-methylthio-2-ketobutyrate
4-methylthio-2-oxobutanoate
4-methylthio-2-oxobutyrate
CPD-479
KMTB
alpha-keto-4-methylthiobutyrate
alpha-keto-gamma-methylthiobutyrate
alpha-keto-gamma-methylthiobutyric acid
alpha-ketomethiobutyrate
alpha-ketomethiobutyric acid
reactome:1237122 4-Methylthio-2-oxobutanoate (1-)
4-methylthio-2-oxobutanoate
4MTOBUTA
sabiork:5424 4-Methylthio-2-oxobutanoate
4-Methylthio-2-oxobutanoic acid
seed:cpd00869 2-keto-4-methylthiobutyrate
2kmb
4-Methylthio-2-oxobutanoate
4-Methylthio-2-oxobutanoic acid
4-methylthio 2-oxobutyrate
deprecated:MNXM146252
deprecated:MNXM89891