Feedback

 

7,8-dihydrofolate

Image of MNXM281
Properties
MNX_IDMNXM281
formulaC19H19N7O6
charge-2
mass441.3986
referencechebi:57451
InChIKeyOZRNSSUDZOLUSN-LBPRGKRZSA-L
InChIInChI=1S/C19H21N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,12,21H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/p-2/t12-/m0/s1
SMILESNc1nc(=O)c2N=C(CNc3ccc(cc3)C(=O)N[C@@H](CCC([O-])=O)C([O-])=O)CNc2[nH]1

This chemical compound does not exist in my selection



Occurrences of 7,8-dihydrofolate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:dhf 7,8-Dihydrofolate
chebi:12245
chebi:14150
chebi:15633
chebi:20768
chebi:42000
chebi:4564
7,8-Dihydrofolate
7,8-Dihydrofolic acid
7,8-Dihydropteroylglutamate
Dihydrofolate
Dihydrofolic acid
N-(4-{[(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid
N-(7,8-dihydropteroyl)-L-glutamic acid
OZRNSSUDZOLUSN-LBPRGKRZSA-N
dihydrofolic acid
chebi:57451 7,8-dihydrofolate
N-(4-{[(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamate
OZRNSSUDZOLUSN-LBPRGKRZSA-L
dihydrofolate dianion
dihydrofolate(2-)
hmdb:HMDB01056 (2S)-2-[(4-{[(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid
Dihydrofolic acid
dihydrofolic acid
kegg:C00415 7,8-Dihydrofolate
7,8-Dihydrofolic acid
7,8-Dihydropteroylglutamate
Dihydrofolate
Dihydrofolic acid
metacyc:DIHYDROFOLATE 7,8-dihydrofolate
7,8-dihydrofolate monoglutamate
7,8-dihydropteroyl monoglutamate
7,8-dihydropteroylglutamate
7,8-pteroylglutamate
7,8-pteroylglutamic acid
DIHYDROFOLATE
H2PteGlu
H2PteGlu1
dihydrofolate
reactome:73604 7,8-Dihydrofolate
7,8-Dihydrofolic acid
DHF
Dihydrofolate
dihydrofolic acid
sabiork:1336 7,8-Dihydrofolate
7,8-Dihydrofolic acid
Dihydrofolate
Dihydrofolic acid
seed:cpd00330 7,8-Dihydrofolate
7,8-Dihydrofolic acid
7,8-Dihydropteroylglutamate
7-8-Dihydrofolate
Dihydrofolate
Dihydrofolic acid
dhf
deprecated:MNXM96451