Feedback

 

sarcosine

Image of MNXM300
Properties
MNX_IDMNXM300
formulaC3H7NO2
charge0
mass89.0932
referencechebi:57433
InChIKeyFSYKKLYZXJSNPZ-UHFFFAOYSA-N
InChIInChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6)
SMILESC[NH2+]CC([O-])=O

This chemical compound does not exist in my selection



Occurrences of sarcosine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:10876
chebi:12609
chebi:15065
chebi:15611
chebi:21765
chebi:45381
chebi:45442
chebi:45531
chebi:45614
chebi:9029
(methylamino)acetic acid
(methylamino)ethanoic acid
FSYKKLYZXJSNPZ-UHFFFAOYSA-N
L-sarcosine
MeGly
N-Methylglycine
N-methylaminoacetic acid
SARCOSINE
Sar
Sarcosine
methylaminoacetic acid
sarcosine
sarcosinic acid
chebi:46842 FSYKKLYZXJSNPZ-UHFFFAOYSA-O
carboxy-N-methylmethanaminium
sarcosinium
chebi:46915 (methylamino)acetate
FSYKKLYZXJSNPZ-UHFFFAOYSA-M
sarcosinate
chebi:57433 (methylammonio)acetate
(methylazaniumyl)acetate
2-(methylazaniumyl)acetate
FSYKKLYZXJSNPZ-UHFFFAOYSA-N
sarcosine
sarcosine zwitterion
bigg:sarcs
envipath:...abb5483b5499
Sarcosine
envipath:...d6ffddb140b3 compound 41902
hmdb:HMDB00271 2-(methylamino)acetic acid
Sarcosine
sarcosine
metacyc:SARCOSINE N-methylglycine
SARCOSINE
sarcosine
reactome:5359017 MeGly
SARC
methylglycine
sarcosine
reactome:6797917 Methylglycine
SARC
sarcosine
kegg:C00213
sabiork:1976
N-Methylglycine
Sarcosine
seed:cpd00183 N-Methylglycine
Sarcosine
sarcs