My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

L-glutamine

Image of MNXM37
Properties
MNX_IDMNXM37
formulaC5H10N2O3
charge0
mass146.1445
referencechebi:58359
InChIKeyZDXPYRJPNDTMRX-VKHMYHEASA-N
InChIInChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1
SMILESNC(=O)CC[C@H]([NH3+])C([O-])=O

This chemical compound does not exist in my selection



Occurrences of L-glutamine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:gln__L L-Glutamine
chebi:13110
chebi:18050
chebi:21308
chebi:42812
chebi:42814
chebi:42899
chebi:42943
chebi:6227
(2S)-2,5-diamino-5-oxopentanoic acid
(2S)-2-amino-4-carbamoylbutanoic acid
(S)-2,5-diamino-5-oxopentanoic acid
GLUTAMINE
Glutamic acid 5-amide
Glutamic acid amide
L-(+)-glutamine
L-2-Aminoglutaramic acid
L-2-aminoglutaramic acid
L-Glutamin
L-Glutamine
L-Glutaminsaeure-5-amid
L-glutamic acid gamma-amide
L-glutamine
Levoglutamide
Q
ZDXPYRJPNDTMRX-VKHMYHEASA-N
chebi:24316
chebi:28300
chebi:5432
2,5-diamino-5-oxopentanoic acid
2-Aminoglutaramic acid
2-amino-4-carbamoylbutanoic acid
Glutamin
Glutamine
Glutaminsaeure-5-amid
Hgln
ZDXPYRJPNDTMRX-UHFFFAOYSA-N
glutamic acid gamma-amide
glutamine
chebi:32665 (2S)-2,5-diamino-5-oxopentanoate
L-glutaminate
L-glutamine anion
ZDXPYRJPNDTMRX-VKHMYHEASA-M
chebi:32666 (1S)-4-amino-1-carboxy-4-oxobutan-1-aminium
L-glutamine cation
L-glutaminium
ZDXPYRJPNDTMRX-VKHMYHEASA-O
chebi:32678 2,5-diamino-5-oxopentanoate
ZDXPYRJPNDTMRX-UHFFFAOYSA-M
gln(-)
glutaminate
glutamine anion
chebi:32679 4-amino-1-carboxy-4-oxobutan-1-aminium
H2gln(+)
ZDXPYRJPNDTMRX-UHFFFAOYSA-O
glutamine cation
glutaminium
chebi:58359 (2S)-5-amino-2-ammonio-5-oxopentanoate
(2S)-5-amino-2-azaniumyl-5-oxopentanoate
L-glutamine
L-glutamine zwitterion
ZDXPYRJPNDTMRX-VKHMYHEASA-N
hmdb:HMDB00641 (2S)-2-amino-4-carbamoylbutanoic acid
L-Glutamine
L-glutamine
kegg:C00064
kegg:D00015
Glutamine (USP)
L-2-Aminoglutaramic acid
L-Glutamine
L-Glutamine (JP17)
Levoglutamide
Nutrestore (TN)
metacyc:GLN 2-aminoglutaramic acid
GLN
L-gln
L-glutamine
Q
gln
glum
glumin
glutamic acid 5-amide
glutamine
proglumide
reactome:113522
reactome:212615
reactome:29472
L-2-Aminoglutaramic acid
L-Gln
L-glutamine
L-glutamine zwitterion
kegg:C00303
sabiork:2011
2-Aminoglutaramic acid
Glutamine
sabiork:74 Gln
L-2-Aminoglutaramic acid
L-Glutamine
seed:cpd00053 L-2-Aminoglutaramic acid
L-Glutamine
gln-L
seed:cpd00253 2-Aminoglutaramic acid
Glutamine
cll_204
deprecated:MNXM114065
deprecated:MNXM8662
deprecated:MNXM96414