Feedback

 

L-aspartate

Image of MNXM42
Properties
MNX_IDMNXM42
formulaC4H6NO4
charge-1
mass132.0953
referencechebi:29991
InChIKeyCKLJMWTZIZZHCS-REOHCLBHSA-M
InChIInChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/p-1/t2-/m0/s1
SMILES[NH3+][C@@H](CC([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of L-aspartate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:CE1787 1-deoxy-1-(N6-lysino)-D-fructose
bigg:CE5868 N-acetyl-seryl-aspartate
bigg:asp__L
envipath:...2b55ea238c15
L-Aspartate
chebi:132943 aspartate
aspartate anion
aspartic acid anion
chebi:17053
chebi:21247
chebi:40853
chebi:40900
chebi:40913
chebi:40942
chebi:6193
(2S)-2-aminobutanedioic acid
(S)-2-aminobutanedioic acid
(S)-2-aminosuccinic acid
2-Aminosuccinic acid
ASPARTIC ACID
Asp
CKLJMWTZIZZHCS-REOHCLBHSA-N
D
L-Asparaginsaeure
L-Aspartic acid
L-aspartic acid
chebi:22660 (+-)-Aspartic acid
(R,S)-Aspartic acid
2-aminobutanedioic acid
Asp
Aspartic acid
CKLJMWTZIZZHCS-UHFFFAOYSA-N
D
DL-Aminosuccinic acid
DL-Asparagic acid
aspartic acid
chebi:13085
chebi:21244
chebi:29991
(2S)-2-ammoniobutanedioate
(2S)-2-ammoniosuccinate
CKLJMWTZIZZHCS-REOHCLBHSA-M
L-aspartate
L-aspartate(1-)
L-aspartic acid monoanion
hydrogen L-aspartate
chebi:29993 (2S)-2-aminobutanedioate
(2S)-2-aminosuccinate
CKLJMWTZIZZHCS-REOHCLBHSA-L
L-aspartate
L-aspartate(2-)
L-aspartic acid dianion
chebi:29995 2-aminobutanedioate
2-aminosuccinate
CKLJMWTZIZZHCS-UHFFFAOYSA-L
aspartate
aspartate(2-)
aspartic acid dianion
chebi:22659
chebi:29992
chebi:35391
2-ammoniobutanedioate
2-ammoniosuccinate
CKLJMWTZIZZHCS-UHFFFAOYSA-M
aspartate(1-)
aspartic acid monoanion
hydrogen aspartate
hmdb:HMDB00191 (2S)-2-aminobutanedioic acid
L-Aspartic acid
L-aspartic acid
hmdb:HMDB62186 1-deoxy-1-(N6-lysino)-D-fructose
2-aminobutanedioic acid
aspartic acid
hmdb:HMDB62501 2-aminobutanedioate
N-acetyl-seryl-aspartate
aspartate(2-)
kegg:C16433 Aspartate
Aspartic acid
kegg:C00049
kegg:D00013
2-Aminosuccinic acid
Aspartic acid (USP/INN)
L-Asp
L-Aspartate
L-Aspartic acid
L-Aspartic acid (JP17)
metacyc:L-ASPARTATE D
L-ASPARTATE
L-asp
L-aspartate
L-aspartic acid
asp
aspartate
aspartic acid
reactome:113553 2-aminosuccinic acid
L-Asp
L-Aspartate
L-aspartate(1-)
L-aspartic acid
reactome:29448 2-aminosuccinate
L-Asp
L-Aspartate
L-aspartate(1-)
L-aspartic acid
sabiork:71 2-Aminosuccinic acid
Asp
L-Aspartate
L-Aspartic acid
seed:cpd00041 2-Aminosuccinic acid
Aspartate
Aspartic acid
L-Aspartate
L-Aspartic acid
asp-L
seed:cpd19181 Aspartate
Aspartic acid
beta-aspartate
deprecated:MNXM10749
deprecated:MNXM114080
deprecated:MNXM96417