Feedback

 

4-aminobenzoate

Image of MNXM421
Properties
MNX_IDMNXM421
formulaC7H6NO2
charge-1
mass136.1286
referencechebi:17836
InChIKeyALYNCZNDIQEVRV-UHFFFAOYSA-M
InChIInChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10)/p-1
SMILESNc1ccc(cc1)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 4-aminobenzoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:4abz
envipath:...a62ebefdc941
4-Aminobenzoate
chebi:11959
chebi:17836
chebi:20314
4-aminobenzoate
4-aminobenzoic acid, ion(1-)
ALYNCZNDIQEVRV-UHFFFAOYSA-M
p-aminobenzoate
chebi:113372
chebi:1783
chebi:20315
chebi:30753
chebi:44778
1-Amino-4-carboxybenzene
4-AMINOBENZOIC ACID
4-Amino-benzoic acid
4-Aminobenzoesaeure
4-Aminobenzoic acid
4-Carboxyaniline
4-Carboxyphenylamine
4-aminobenzoic acid
ABEE
ALYNCZNDIQEVRV-UHFFFAOYSA-N
PABA
gamma-Aminobenzoic acid
gamma-aminobenzoic acid
p-Aminobenzoesaeure
p-aminobenzoic acid
p-carboxyaniline
p-carboxyphenylamine
para-aminobenzoic acid
kegg:C00568
kegg:D02456
4-Aminobenzoate
4-Aminobenzoic acid
ABEE
Aminobenzoic acid (USP)
RVPaba lipstick (TN)
p-Aminobenzoate
p-Aminobenzoic acid
metacyc:P-AMINO-BENZOATE 4-aminobenzoate
4-aminobenzoic acid
P-AMINO-BENZOATE
p-aminobenzoate
p-aminobenzoic acid
pABA
para-aminobenzoate
para-aminobenzoic acid
sabiork:2099 4-Aminobenzoate
4-Aminobenzoic acid
ABEE
p-Aminobenzoate
seed:cpd00443 4-Aminobenzoate
4-Aminobenzoic acid
4abz
ABEE
p-Aminobenzoate