Feedback

 

2-dehydro-3-deoxy-D-galactonate

MNXM440 is deprecated and replaced by MNXM1627
Image of MNXM1627
Properties
MNX_IDMNXM1627
formulaC6H9O6
charge-1
mass177.1326
referencechebi:57989
InChIKeyWPAMZTWLKIDIOP-NQXXGFSBSA-M
InChIInChI=1S/C6H10O6/c7-2-5(10)3(8)1-4(9)6(11)12/h3,5,7-8,10H,1-2H2,(H,11,12)/p-1/t3-,5-/m1/s1
SMILESOC[C@@H](O)[C@H](O)CC(=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 2-dehydro-3-deoxy-D-galactonate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:2ddglcn
sabiork:1973
2-Dehydro-3-deoxy-D-gluconate
bigg:2dh3dgal
kegg:C01216
sabiork:5451
2-Dehydro-3-deoxy-D-galactonate
chebi:1059
chebi:11550
chebi:17032
chebi:19530
2-Dehydro-3-deoxy-D-gluconate
2-Keto-3-deoxy-D-gluconate
2-dehydro-3-deoxy-D-gluconate
2-dehydro-3-deoxy-D-gluconic acid
3-Deoxy-2-oxo-D-gluconate
3-deoxy-D-erythro-2-hexulosonic acid
3-deoxy-D-erythro-hex-2-ulosonic acid
WPAMZTWLKIDIOP-WVZVXSGGSA-N
chebi:1056
chebi:11547
chebi:17028
chebi:19527
2-Dehydro-3-deoxy-D-galactonate
2-dehydro-3-deoxy-D-galactonic acid
3-deoxy-D-threo-hex-2-ulosonic acid
WPAMZTWLKIDIOP-NQXXGFSBSA-N
chebi:57989 2-dehydro-3-deoxy-D-galactonate
2-dehydro-3-deoxy-D-galactonate anion
2-dehydro-3-deoxy-D-galactonate(1-)
3-deoxy-D-threo-hex-2-ulosonate
WPAMZTWLKIDIOP-NQXXGFSBSA-M
chebi:57990 2-dehydro-3-deoxy-D-gluconate
2-dehydro-3-deoxy-D-gluconate anion
2-dehydro-3-deoxy-D-gluconate(1-)
3-deoxy-D-erythro-hex-2-ulosonate
WPAMZTWLKIDIOP-WVZVXSGGSA-M
hmdb:HMDB01353 (4R,5R)-4,5,6-trihydroxy-2-oxohexanoic acid
2-Keto-3-deoxy-D-gluconic acid
kegg:C00204 2-Dehydro-3-deoxy-D-gluconate
2-Keto-3-deoxy-D-gluconate
lipidmaps:LMFA01050475 2-dehydro-3-deoxy-D-gluconic acid
3-Deoxy-2-oxo-D-gluconate
3-deoxy-D-erythro-2-hexulosonic acid
3-deoxy-D-erythro-hex-2-ulosonic acid
lipidmaps:LMFA01050475
lipidmaps:LMFA01050486 (4R,5R)-4,5,6-trihydroxy-2-oxohexanoic acid
2-Keto-3-deoxy-D-gluconic acid
lipidmaps:LMFA01050486
metacyc:2-DEHYDRO-3-DEOXY-D-GALACTONATE 2-DEHYDRO-3-DEOXY-D-GALACTONATE
2-dehydro-3-deoxy-D-galactonate
2-dehydro-3-deoxygalactonate
2-keto-3-deoxy-D-galactonate
2-keto-3-deoxygalactonate
metacyc:2-DEHYDRO-3-DEOXY-D-GLUCONATE 2-DEHYDRO-3-DEOXY-D-GLUCONATE
2-dehydro-3-deoxy-D-gluconate
2-keto-3-deoxy-D-gluconate
2-keto-3-deoxy-D-gluconic acid
2-keto-3-deoxygluconate
3-deoxy-2-oxo-D-gluconate
3-deoxy-D-erythro-hex-2-ulosonic acid
KDG
sabiork:21126 2-Keto-3-deoxy-D-galactonate
sabiork:21127 2-Keto-3-deoxy-D-gluconate
2-Keto-3-deoxy-D-gluconic acid
seed:cpd00176 2-Dehydro-3-deoxy-D-gluconate
2-keto-3-deoxygluconate
2ddglcn
seed:cpd00894 2-Dehydro-3-deoxy-D-galactonate
2dh3dgal
deprecated:MNXM440