Feedback

 

3'-phosphoadenylyl sulfate

Image of MNXM49
Properties
MNX_IDMNXM49
formulaC10H11N5O13P2S
charge-4
mass503.235
referencechebi:58339
InChIKeyGACDQMDRPRGCTN-KQYNXXCUSA-J
InChIInChI=1S/C10H15N5O13P2S/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7(27-29(17,18)19)4(26-10)1-25-30(20,21)28-31(22,23)24/h2-4,6-7,10,16H,1H2,(H,20,21)(H2,11,12,13)(H2,17,18,19)(H,22,23,24)/p-4/t4-,6-,7-,10-/m1/s1
SMILESNc1ncnc2n(cnc12)[C@@H]1O[C@H](COP([O-])(=O)OS([O-])(=O)=O)[C@@H](OP([O-])([O-])=O)[C@H]1O

This chemical compound does not exist in my selection



Occurrences of 3'-phosphoadenylyl sulfate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:paps 3'-Phosphoadenylyl sulfate
chebi:11679
chebi:11680
chebi:1353
chebi:17980
chebi:19857
3'-O-phosphono-5'-adenylyl sulfate
3'-Phospho-5'-adenylyl sulfate
3'-Phosphoadenosine 5'-phosphosulfate
3'-Phosphoadenylyl sulfate
3'-phospho-5'-adenylyl sulfate
3'-phosphoadenosine 5'-phosphosulfate
GACDQMDRPRGCTN-KQYNXXCUSA-N
PAPS
chebi:58339 3'-O-phosphonato-5'-O-[(sulfonatooxy)phosphinato]adenosine
3'-phosphoadenylyl sulfate
3'-phosphonato-5'-adenylyl sulfate
3'-phosphonato-5'-adenylyl sulfate tetraanion
3'-phosphonato-5'-adenylyl sulfate(4-)
3'-phosphonatoadenosine 5'-phosphosulfate
3'-phosphonatoadenosine 5'-phosphosulfate tetraanion
3'-phosphonatoadenosine 5'-phosphosulfate(4-)
GACDQMDRPRGCTN-KQYNXXCUSA-J
PAPS
PAPS tetraanion
PAPS(4-)
hmdb:HMDB62646 (2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-({[(sulfonatooxy)phosphinato]oxy}methyl)oxolan-3-yl phosphate
3'-phosphonato-5'-adenylyl Sulfate(4-)
PAPS
kegg:C00053 3'-Phospho-5'-adenylyl sulfate
3'-Phosphoadenosine 5'-phosphosulfate
3'-Phosphoadenylyl sulfate
PAPS
metacyc:PAPS 3'-phospho-5'-adenylyl sulfate
3'-phosphoadenosine-5'-phosphosulfate
3'-phosphoadenylyl sulfate
3'-phosphoadenylyl-sulfate
PAPS
phosphoadenosine phosphosulfate
phosphoadenosine-5'-phosphosulfate
reactome:158471
reactome:741440
3'-phospho-5'-adenylyl sulfate
PAPS
sabiork:1776 3'-Phospho-5'-adenylyl sulfate
3'-Phosphoadenosine 5'-phosphosulfate
3'-Phosphoadenylyl sulfate
3'-Phosphoadenylylsulfate
PAPS
seed:cpd00044 3'-Phospho-5'-adenylyl sulfate
3'-Phosphoadenosine 5'-phosphosulfate
3'-Phosphoadenylyl sulfate
3-Phosphoadenylylsulfate
3-phospho-adenylylsulfate
3-phosphoadenylyl sulfate
3-phosphoadenylylsulfate
PAPS
paps
deprecated:MNXM89597
deprecated:MNXM89710