My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)-pyrimidine

Image of MNXM648
Properties
MNX_IDMNXM648
formulaC9H14N5O8P
charge-2
mass351.211
referencechebi:58614
InChIKeyOCLCLRXKNJCOJD-UMMCILCDSA-L
InChIInChI=1S/C9H16N5O8P/c10-3-6(13-9(11)14-7(3)17)12-8-5(16)4(15)2(22-8)1-21-23(18,19)20/h2,4-5,8,15-16H,1,10H2,(H2,18,19,20)(H4,11,12,13,14,17)/p-2/t2-,4-,5-,8-/m1/s1
SMILESNc1nc(=O)c(N)c(N[C@@H]2O[C@H](COP([O-])([O-])=O)[C@@H](O)[C@H]2O)[nH]1

This chemical compound does not exist in my selection



Occurrences of 2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)-pyrimidine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:25drapp 2,5-Diamino-6-(ribosylamino)-4-(3H)-pyrimidinone 5'-phosphate
chebi:11446
chebi:19368
chebi:29114
chebi:927
1-deoxy-1-[(2,5-diamino-6-hydroxypyrimidin-3-yl)amino]-beta-D-ribofuranose 5-(dihydrogen phosphate)
2,5-Diamino-6-hydroxy-4-(5'-phosphoribosylamino)-pyrimidine
2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine
2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine
N-(2,5-diamino-6-hydroxypyrimidin-4-yl)-5-O-phosphono-beta-D-ribofuranosylamine
OCLCLRXKNJCOJD-UMMCILCDSA-N
chebi:58614 1-deoxy-1-[(2,5-diamino-6-hydroxypyrimidin-3-yl)amino]-beta-D-ribofuranose 5-phosphate
2,5-diamino-4-hydroxy-6-(5-phosphonatoribosylamino)pyrimidine(3-)
2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)-pyrimidine
N-(2,5-diamino-6-hydroxypyrimidin-4-yl)-5-O-phosphonato-beta-D-ribofuranosylamine
OCLCLRXKNJCOJD-UMMCILCDSA-L
chebi:59545 2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-monophosphate(2-)
2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate(2-)
2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one(2-)
APy(2-)
N-(2,5-diamino-6-oxo-1,6-dihydropyrimidin-4-yl)-5-O-phosphonato-beta-D-ribofuranosylamine
OCLCLRXKNJCOJD-UMMCILCDSA-L
chebi:59546 2,5-Diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
2,5-diamino-6-(1-D-ribosylamino)-4(3H)-pyrimidinone 5'-phosphate
2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-monophosphate
2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one
2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-monophosphate
2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate
APy
N-(2,5-diamino-6-oxo-1,6-dihydropyrimidin-4-yl)-5-O-phosphono-beta-D-ribofuranosylamine
OCLCLRXKNJCOJD-UMMCILCDSA-N
kegg:C01304 2,5-Diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
2,5-Diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one
metacyc:DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR 2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one
2,5-diamino-6-(D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
2,5-diamino-6-(ribosylamino)-4-(3H)-pyrimidinone 5'-phosphate
2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine
DARP
DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR
seed:cpd00957 2,5-Diamino-6-(5'-phosphoribosylamino)-4-pyrimidineone
2,5-Diamino-6-(ribosylamino)-4-(3H)-pyrimidinone 5'-phosphate
2,5-Diamino-6-hydroxy-4-(5'-phosphoribosylamino)-pyrimidine
2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine
2-5-Diamino-6-hydroxy-4--5-phosphoribosylamino-pyrimidine
25drapp
seed:cpd29703 2,5-Diamino-6-(5'-phosphoribosylamino)-4-pyrimidineone
deprecated:MNXM90905
deprecated:MNXM9771