Feedback

 

glyoxylate

Image of MNXM69
Properties
MNX_IDMNXM69
formulaC2HO3
charge-1
mass73.0281
referencechebi:36655
InChIKeyHHLFWLYXYJOTON-UHFFFAOYSA-M
InChIInChI=1S/C2H2O3/c3-1-2(4)5/h1H,(H,4,5)/p-1
SMILES[H]C(=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of glyoxylate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:14368
chebi:24420
chebi:35977
chebi:36655
Glyoxylat
HHLFWLYXYJOTON-UHFFFAOYSA-M
glyoxylate
oxoacetate
chebi:16891
chebi:24421
chebi:42767
chebi:5509
GLYOXYLIC ACID
Glyoxalate
Glyoxalsaeure
Glyoxylate
Glyoxylic acid
Glyoxylsaeure
HHLFWLYXYJOTON-UHFFFAOYSA-N
alpha-ketoacetic acid
formylformic acid
glyoxylic acid
oxalaldehydic acid
oxoacetic acid
oxoethanoic acid
bigg:glx
envipath:...d857bfaa198a
Glyoxylate
envipath:...6a072f4f963c compound 866
envipath:...501b036f9626 compound 2530
envipath:...c97d8e9eed48 compound 37973
hmdb:HMDB00119 2-oxoacetic acid
Glyoxylic acid
glyoxylic acid
kegg:C00048
sabiork:1838
Glyoxalate
Glyoxylate
Glyoxylic acid
metacyc:GLYOX GLYOX
glyox
glyoxalate
glyoxylate
glyoxylic acid
reactome:389678
reactome:904849
glyoxylate
glyoxylic acid
seed:cpd00040 Glyoxalate
Glyoxylate
Glyoxylic acid
glx
deprecated:MNXM89656