Feedback

 

L-arginine

Image of MNXM70
Properties
MNX_IDMNXM70
formulaC6H15N4O2
charge1
mass175.2084
referencechebi:32682
InChIKeyODKSFYDXXFIFQN-BYPYZUCNSA-O
InChIInChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/p+1/t4-/m0/s1
SMILESNC(=[NH2+])NCCC[C@H]([NH3+])C([O-])=O

This chemical compound does not exist in my selection



Occurrences of L-arginine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:arg__L L-Arginine
chebi:13077
chebi:16467
chebi:21235
chebi:42927
chebi:6185
(2S)-2-amino-5-(carbamimidamido)pentanoic acid
(2S)-2-amino-5-guanidinopentanoic acid
(S)-2-Amino-5-guanidinovaleric acid
(S)-2-amino-5-guanidinopentanoic acid
Arg
L-(+)-arginine
L-Arg
L-Arginin
L-Arginine
L-arginine
ODKSFYDXXFIFQN-BYPYZUCNSA-N
R
arginine
chebi:22616
chebi:2643
chebi:29016
2-Amino-5-guanidinovaleric acid
2-amino-5-(carbamimidamido)pentanoic acid
2-amino-5-guanidinopentanoic acid
Arginin
Arginine
Harg
ODKSFYDXXFIFQN-UHFFFAOYSA-N
arginine
chebi:32681 (2S)-2-amino-5-(carbamimidamido)pentanoate
(2S)-2-amino-5-guanidinopentanoate
L-argininate
L-arginine anion
ODKSFYDXXFIFQN-BYPYZUCNSA-M
chebi:133495
chebi:32682
(2S)-2-amino-5-(carbamimidamido)pentanoate
(2S)-2-amino-5-guanidinopentanoate
(2S)-2-ammonio-5-guanidiniopentanoate
(2S)-2-azaniumyl-5-{[azaniumyl(imino)methyl]amino}pentanoate
L-arginine
L-arginine cation
L-arginine monocation
L-argininium
L-argininium(1+)
ODKSFYDXXFIFQN-BYPYZUCNSA-O
arginine(1+)
chebi:32683 L-arginine dication
L-argininediium
L-argininium(2+)
ODKSFYDXXFIFQN-BYPYZUCNSA-P
[(1S)-1-carboxy-4-guanidiniobutyl]ammonium
chebi:32695 2-amino-5-(carbamimidamido)pentanoate
2-amino-5-guanidinopentanoate
ODKSFYDXXFIFQN-UHFFFAOYSA-M
arg(-)
argininate
arginine anion
chebi:32696 2-ammonio-5-guanidiniopentanoate
H2arg(+)
ODKSFYDXXFIFQN-UHFFFAOYSA-O
arginine
arginine monocation
argininium
argininium(1+)
chebi:32697 (1-carboxy-4-guanidiniobutyl)ammonium
H3arg(2+)
ODKSFYDXXFIFQN-UHFFFAOYSA-P
arginine dication
argininediium
argininium(2+)
hmdb:HMDB00517 (2S)-2-amino-5-carbamimidamidopentanoic acid
L-Arginine
L-arginine
hmdb:HMDB62762 D-arginine
L-argininium(1+)
[amino({[(4S)-4-amino-4-carboxybutyl]amino})methylidene]azanium
kegg:C00062
kegg:D02982
(S)-2-Amino-5-guanidinovaleric acid
Arginine (USP/INN)
L-Arg
L-Arginine
L-Arginine (JP17)
metacyc:ARG 2-amino-5-guanidinovaleric acid
ARG
L-arg
L-arginine
R
arg
arginine
reactome:113530
reactome:29468
reactome:351977
reactome:374064
(S)-2-Amino-5-guanidinovaleric acid
L-Arg
L-arginine
L-argininium(1+)
sabiork:23080 L-Argininic acid
sabiork:2410 2-Amino-5-guanidinovaleric acid
Arginine
sabiork:80 (S)-2-Amino-5-guanidinovaleric acid
Arg
L-Arginine
seed:cpd00051 (S)-2-Amino-5-guanidinovaleric acid
2-Amino-5-guanidinovaleric acid
Amino acid(Arg-)
Arginine
L-Arginine
arg-L
kegg:C02385
seed:cpd19021
2-Amino-5-guanidinovaleric acid
Amino acid(Arg-)
Arginine
deprecated:MNXM10738
deprecated:MNXM96427