Feedback

 

L-lysine

Image of MNXM78
Properties
MNX_IDMNXM78
formulaC6H15N2O2
charge1
mass147.195
referencechebi:32551
InChIKeyKDXKERNSBIXSRK-YFKPBYRVSA-O
InChIInChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/p+1/t5-/m0/s1
SMILES[NH3+]CCCC[C@H]([NH3+])C([O-])=O

This chemical compound does not exist in my selection



Occurrences of L-lysine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:lys__L L-Lysine
chebi:133538 (2S)-6-amino-2-azaniumylhexanoate
KDXKERNSBIXSRK-YFKPBYRVSA-N
L-lysine
L-lysine zwitterion
Lys
lysine zwitterion
chebi:13135
chebi:18019
chebi:21351
chebi:43950
chebi:6264
(2S)-2,6-diaminohexanoic acid
(S)-2,6-diaminohexanoic acid
(S)-alpha,epsilon-diaminocaproic acid
(S)-lysine
6-ammonio-L-norleucine
K
KDXKERNSBIXSRK-YFKPBYRVSA-N
L-2,6-Diaminocaproic acid
L-Lysin
L-Lysine
L-lysine
Lys
Lysine acid
lysina
lysine
lysinum
chebi:25094 2,6-diaminohexanoic acid
K
KDXKERNSBIXSRK-UHFFFAOYSA-N
LYS
Lysin
alpha,epsilon-diaminocaproic acid
lysine
chebi:32550 (2S)-2,6-diaminohexanoate
KDXKERNSBIXSRK-YFKPBYRVSA-M
L-lysinate
L-lysine anion
chebi:32551 (2S)-2,6-diammoniohexanoate
KDXKERNSBIXSRK-YFKPBYRVSA-O
L-lysine
L-lysine monocation
L-lysinium
L-lysinium(1+)
chebi:32552 (1S)-1-carboxypentane-1,5-diaminium
KDXKERNSBIXSRK-YFKPBYRVSA-P
L-lysine dication
L-lysinediium
L-lysinium(2+)
chebi:32563 2,6-diaminohexanoate
KDXKERNSBIXSRK-UHFFFAOYSA-M
lys(-)
lysinate
lysine anion
chebi:32564 2,6-diammoniohexanoate
KDXKERNSBIXSRK-UHFFFAOYSA-O
lysine monocation
lysinium
lysinium(1+)
chebi:32565 1-carboxypentane-1,5-diaminium
KDXKERNSBIXSRK-UHFFFAOYSA-P
lysine dication
lysinediium
lysinium(2+)
hmdb:HMDB62809 (5S)-5-amino-5-carboxypentan-1-aminium
L-lysinium(1+)
kegg:C00047
kegg:D02304
2,6-Diaminohexanoic acid
L-Lysine
Lysine (USAN/INN)
Lysine acid
metacyc:LYS 2,6-diaminohexanoic acid
K
L-lys
L-lysine
LYS
lys
lysine
lysine acid
reactome:29444
reactome:351979
reactome:351991
2,6-diaminohexanoic acid
L-Lys
L-lysine
L-lysinium(1+)
Lysine acid
sabiork:79 2,6-Diaminohexanoic acid
2,6-diaminohexanoic acid
L-Lysine
Lys
Lysine acid
seed:cpd00039 2,6-Diaminohexanoic acid
L-Lysine
Lysine
Lysine acid
lys-L
kegg:C16440
sabiork:22945
seed:cpd19182
Lysine
deprecated:MNXM157568
deprecated:MNXM89753