My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

(6S)-5,6,7,8-tetrahydrofolate

Image of MNXM79
Properties
MNX_IDMNXM79
formulaC19H21N7O6
charge-2
mass443.4144
referencechebi:57453
InChIKeyMSTNYGQPCMXVAQ-RYUDHWBXSA-L
InChIInChI=1S/C19H23N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,11-12,21,23H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/p-2/t11-,12-/m0/s1
SMILESNc1nc(=O)c2N[C@@H](CNc3ccc(cc3)C(=O)N[C@@H](CCC([O-])=O)C([O-])=O)CNc2[nH]1

This chemical compound does not exist in my selection



Occurrences of (6S)-5,6,7,8-tetrahydrofolate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:thf 5,6,7,8-Tetrahydrofolate
chebi:20506 (6S)-THFA
(6S)-Tetrahydrofolate
(6S)-Tetrahydrofolic acid
5,6,7,8-Tetrahydrofolate
5,6,7,8-tetrahydrofolic acid
MSTNYGQPCMXVAQ-KIYNQFGBSA-N
N-[4-{[(2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}benzoyl]-L-glutamic acid
THF
Tetrahydrofolic acid
tetrahydrofolate
tetrahydrofolic acid
chebi:10931
chebi:12075
chebi:15220
chebi:15635
chebi:18606
chebi:46069
chebi:9482
(6S)-5,6,7,8-TETRAHYDROFOLATE
(6S)-5,6,7,8-tetrahydrofolate
(6S)-5,6,7,8-tetrahydrofolic acid
(6S)-5,6,7,8-tetrahydropteroylglutamate
(6S)-H4folate
(6S)-THFA
(6S)-Tetrahydrofolate
(6S)-Tetrahydrofolic acid
(6S)-tetrahydrofolate
5,6,7,8-Tetrahydrofolate
MSTNYGQPCMXVAQ-RYUDHWBXSA-N
N-(5,6,7,8-tetrahydropteroyl)-L-glutamic acid
N-[4-({[(6S)-2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamic acid
THF
Tetrahydrofolate
Tetrahydrofolic acid
chebi:57453 (6S)-5,6,7,8-tetrahydrofolate
(6S)-5,6,7,8-tetrahydrofolate dianion
(6S)-5,6,7,8-tetrahydrofolate(2-)
MSTNYGQPCMXVAQ-RYUDHWBXSA-L
N-[4-({[(6S)-2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamate
chebi:68437 (2S)-2-[(4-{[(2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}benzoyl)amino]pentanedioate
5,6,7,8-tetrahydrofolate
5,6,7,8-tetrahydrofolate(2-)
MSTNYGQPCMXVAQ-KIYNQFGBSA-L
hmdb:HMDB62806 (4S)-4-carboxy-4-{[4-({[(6S)-2-imino-4-oxido-1,2,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)phenyl]formamido}butanoate
(4S)-4-carboxy-4-{[4-({[(6S)-2-imino-4-oxido-5,6,7,8-tetrahydro-1H-pteridin-6-yl]methyl}amino)phenyl]formamido}butanoate
(6S)-5,6,7,8-tetrahydrofolate(2-)
kegg:C00101 (6S)-THFA
(6S)-Tetrahydrofolate
(6S)-Tetrahydrofolic acid
5,6,7,8-Tetrahydrofolate
THF
Tetrahydrofolate
Tetrahydrofolic acid
metacyc:THF (6S)-tetrahydrofolate
5,6,7,8-tetrahydrofolate
5,6,7,8-tetrahydrofolic acid
FH4
H4F
H4PteGlu
H4PteGlu1
THF
folate-H4
tetra-H-folate
tetrahydrafolate
tetrahydrofolate
tetrahydrofolic acid
tetrahydropteroyl mono-L-glutamate
tetrahydropteroylglutamate
th-folate
vitamin B9
reactome:111355
reactome:200671
(6S)-5,6,7,8-tetrahydrofolic acid
5,6,7,8-tetrahydrofolate
THF
Tetrahydrofolate
tetrahydrofolic acid
sabiork:1297 (6S)-THFA
(6S)-Tetrahydrofolate
(6S)-Tetrahydrofolic acid
5,6,7,8-Tetrahydrofolate
FH4
THF
Tetrahydrofolate
Tetrahydrofolic acid
Tetrahydropteroylglutamate
seed:cpd00087 (6S)-THFA
(6S)-Tetrahydrofolate
(6S)-Tetrahydrofolic acid
5,6,7,8-Tetrahydrofolate
5-6-7-8-Tetrahydrofolate
THF
Tetrahydrofolate
Tetrahydrofolic acid
thf
deprecated:MNXM89642
deprecated:MNXM89718
deprecated:MNXM96423