Feedback

 

fumarate

Image of MNXM93
Properties
MNX_IDMNXM93
formulaC4H2O4
charge-2
mass114.0574
referencechebi:29806
InChIKeyVZCYOOQTPOCHFL-OWOJBTEDSA-L
InChIInChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/p-2/b2-1+
SMILES[O-]C(=O)\C=C\C([O-])=O

This chemical compound does not exist in my selection



Occurrences of fumarate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:22958 2-butenedioic acid
VZCYOOQTPOCHFL-UHFFFAOYSA-N
but-2-enedioic acid
butenedioic acid
chebi:14284
chebi:24122
chebi:29806
chebi:42511
(2E)-but-2-enedioate
(E)-2-butenedioic acid, ion(2-)
FUMARATE
VZCYOOQTPOCHFL-OWOJBTEDSA-L
fumarate
fumarate(2-)
chebi:22956
chebi:22957
chebi:36180
VZCYOOQTPOCHFL-UHFFFAOYSA-L
but-2-enedioate
butenedioate
chebi:37154 (2E)-3-carboxyacrylate
(2E)-3-carboxyprop-2-enoate
VZCYOOQTPOCHFL-OWOJBTEDSA-M
fumarate monoanion
fumarate(1-)
hydrogen fumarate
chebi:37155 3-carboxyacrylate
3-carboxyprop-2-enoate
VZCYOOQTPOCHFL-UHFFFAOYSA-M
hydrogen butenedioate
chebi:18012
chebi:24124
chebi:42743
chebi:5190
(2E)-2-butenedioic acid
(2E)-but-2-enedioic acid
(E)-2-butenedioic acid
E297
FUMARIC ACID
Fumaric acid
Fumarsaeure
VZCYOOQTPOCHFL-OWOJBTEDSA-N
fumaric acid
trans-1,2-ethylenedicarboxylic acid
trans-Butenedioic acid
trans-but-2-enedioic acid
bigg:fum
envipath:...06428f6be14b
Fumarate
hmdb:HMDB00134 (2E)-but-2-enedioic acid
Fumaric acid
fumaric acid
kegg:C00122
kegg:D02308
Fumarate
Fumaric acid
Fumaric acid (NF)
trans-Butenedioic acid
metacyc:FUM FUM
fum
fumarate
fumaric acid
reactome:113588 FUMA
Fumarate
Trans-butenedioic acid
fumaric acid
reactome:29586 FUMA
Fumarate
fumarate(1-)
sabiork:1910 Fumarate
Fumaric acid
trans-Butenedioic acid
trans-butenedioic acid
seed:cpd00106 Fumarate
Fumaric acid
fum
trans-Butenedioic acid
deprecated:MNXM152980
deprecated:MNXM156184
deprecated:MNXM156612
deprecated:MNXM89685
deprecated:MNXM89729