Feedback

 

L-phenylalanine

Image of MNXM97
Properties
MNX_IDMNXM97
formulaC9H11NO2
charge0
mass165.1891
referencechebi:58095
InChIKeyCOLNVLDHVKWLRT-QMMMGPOBSA-N
InChIInChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1
SMILES[NH3+][C@@H](Cc1ccccc1)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of L-phenylalanine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:phe__L L-Phenylalanine
chebi:25984
chebi:28044
chebi:8089
2-amino-3-phenylpropanoic acid
COLNVLDHVKWLRT-UHFFFAOYSA-N
DL-Phenylalanine
F
PHE
Phenylalanin
Phenylalanine
alpha-Amino-beta-phenylpropionic acid
fenilalanina
phenylalanine
chebi:32486 (2S)-2-amino-3-phenylpropanoate
COLNVLDHVKWLRT-QMMMGPOBSA-M
L-phenylalaninate
L-phenylalanine anion
chebi:32487 (1S)-1-carboxy-2-phenylethanaminium
COLNVLDHVKWLRT-QMMMGPOBSA-O
L-phenylalanine cation
L-phenylalaninium
chebi:32504 2-amino-3-phenylpropanoate
COLNVLDHVKWLRT-UHFFFAOYSA-M
phenylalaninate
phenylalanine anion
chebi:32505 1-carboxy-2-phenylethanaminium
COLNVLDHVKWLRT-UHFFFAOYSA-O
phenylalanine cation
phenylalaninium
chebi:13151
chebi:17295
chebi:21370
chebi:44851
chebi:44885
chebi:45079
chebi:6282
(2S)-2-amino-3-phenylpropanoic acid
(S)-2-Amino-3-phenylpropionic acid
(S)-alpha-Amino-beta-phenylpropionic acid
3-phenyl-L-alanine
COLNVLDHVKWLRT-QMMMGPOBSA-N
F
L-Phenylalanine
L-phenylalanine
PHENYLALANINE
Phe
beta-phenyl-L-alanine
chebi:58095 (2S)-2-ammonio-3-phenylpropanoate
(2S)-2-azaniumyl-3-phenylpropanoate
COLNVLDHVKWLRT-QMMMGPOBSA-N
L-phenylalanine
L-phenylalanine zwitterion
phenylalanine
chebi:76052 (2,3,4,5,6-()H5)phenylalanine
2,3,4,5,6-pentadeuteriophenylalanine
COLNVLDHVKWLRT-RALIUCGRSA-N
phenylalanine-d5
envipath:...c0533f3e6047 compound 42609
envipath:...ac0f47865b8b compound 42520
hmdb:HMDB00159
hmdb:HMDB00612
(2S)-2-amino-3-phenylpropanoic acid
L-Phenylalanine
L-phenylalanine
kegg:C00079
kegg:D00021
(S)-alpha-Amino-beta-phenylpropionic acid
L-Phenylalanine
L-Phenylalanine (JP17)
Phenylalanine (USP/INN)
kegg:C02057
sabiork:2365
Phenylalanine
alpha-Amino-beta-phenylpropionic acid
metacyc:PHE 2S-alpha-phenylalanine
F
L-phe
L-phenylalanine
PHE
endophenyl
phe
phenylalanine
reactome:29502
reactome:351993
reactome:379701
(S)-alpha-amino-beta-phenylpropionic acid
L-Phe
L-phenylalanine
L-phenylalanine zwitterion
sabiork:83 (S)-alpha-Amino-beta-phenylpropionic acid
L-Phenylalanine
Phe
seed:cpd00066 (S)-alpha-Amino-beta-phenylpropionic acid
L-Phenylalanine
phe-L
seed:cpd01400 Phenylalanine
alpha-Amino-beta-phenylpropionic acid
cll_481
deprecated:MNXM20420
deprecated:MNXM96433