Feedback

 

(S)-malate

Image of MNXM98
Properties
MNX_IDMNXM98
formulaC4H4O5
charge-2
mass132.0727
referencechebi:15589
InChIKeyBJEPYKJPYRNKOW-REOHCLBHSA-L
InChIInChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/p-2/t2-/m0/s1
SMILESO[C@@H](CC([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (S)-malate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:mal__L L-Malate
chebi:11066
chebi:13140
chebi:15589
chebi:18784
(2S)-2-hydroxybutanedioate
(S)-malate
(S)-malate(2-)
BJEPYKJPYRNKOW-REOHCLBHSA-L
L-malate
chebi:18785
chebi:30797
chebi:423
(-)-L-malic acid
(2S)-2-hydroxybutanedioic acid
(S)-(-)-Hydroxysuccinic acid
(S)-malic acid
BJEPYKJPYRNKOW-REOHCLBHSA-N
L-2-Hydroxybutanedioic acid
L-Apple acid
L-Malic acid
L-malic acid
Malate
Malic acid
S-2-Hydroxybutanedioic acid
hmdb:HMDB00156 (-)-malic acid
(2S)-2-hydroxybutanedioic acid
L-Malic acid
kegg:C00149 (S)-Malate
L-2-Hydroxybutanedioic acid
L-Apple acid
L-Malate
L-Malic acid
Malate
Malic acid
metacyc:MAL (S)-malate
(S)-malic acid
L-apple acid
L-hydroxybutanedioic acid
L-hydroxysuccinic acid
L-malate
L-malic acid
MAL
reactome:113544
reactome:198498
(S)-Malate
(S)-malic acid
L-2-Hydroxybutanedioic acid
L-Apple acid
L-Malate
L-Malic acid
MAL
sabiork:1918 (S)-Malate
L-2-Hydroxybutanedioic acid
L-Apple acid
L-Malate
L-Malic acid
seed:cpd00130 (S)-Malate
2-Hydroxybutanedioic acid
L-2-Hydroxybutanedioic acid
L-Apple acid
L-Malate
L-Malic acid
MALA
Malate
Malic acid
mal-L
deprecated:MNXM89610