My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

(2S)-2-amino-3-oxobutanoate

Image of MNXM114087
Properties
MNX_IDMNXM114087
formulaC4H7NO3
charge0
mass117.1033
referencechebi:78948
InChIKeySAUCHDKDCUROAO-VKHMYHEASA-N
InChIInChI=1S/C4H7NO3/c1-2(6)3(5)4(7)8/h3H,5H2,1H3,(H,7,8)/t3-/m0/s1
SMILESCC(=O)[C@H]([NH3+])C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (2S)-2-amino-3-oxobutanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:2aobut L-2-Amino-3-oxobutanoate
chebi:13048
chebi:16944
chebi:21195
chebi:6156
(2S)-2-amino-3-oxobutanoate
L-2-Amino-3-oxobutanoate
L-2-Amino-acetoacetate
L-2-amino-3-oxobutanoate
SAUCHDKDCUROAO-VKHMYHEASA-M
chebi:35229
chebi:40668
chebi:40673
(2S)-2-amino-3-oxobutanoic acid
(S)-2-Amino-3-oxobutanoic acid
2-AMINO-3-KETOBUTYRIC ACID
L-2-Amino-3-oxobutanoate
L-2-Amino-3-oxobutanoic acid
L-2-Amino-acetoacetate
L-2-amino-3-oxobutanoic acid
SAUCHDKDCUROAO-VKHMYHEASA-N
chebi:78948 (2S)-2-amino-3-oxobutanoate
(2S)-2-ammonio-3-oxobutanoate
(2S)-2-azaniumyl-3-oxobutanoate
L-2-amino-3-oxobutanoic acid zwitterion
SAUCHDKDCUROAO-VKHMYHEASA-N
hmdb:HMDB06454 (2S)-2-amino-3-oxobutanoic acid
2-amino-3-ketobutyric acid
L-2-Amino-3-oxobutanoic acid
kegg:C03508 (S)-2-Amino-3-oxobutanoic acid
L-2-Amino-3-oxobutanoate
L-2-Amino-3-oxobutanoic acid
L-2-Amino-acetoacetate
lipidmaps:LMFA01060172 2S-amino-3-oxo-butanoic acid
L-2-Amino-3-oxobutanoic acid
lipidmaps:LMFA01060172
metacyc:AMINO-OXOBUT 3-keto-L-threonine
3-oxothreonine
AMINO-OXOBUT
L-2-amino-3-ketobutyrate
L-2-amino-3-oxobutanoate
L-2-amino-3-oxobutyrate
L-2-amino-acetoacetate
alpha-amino-beta-ketobutyrate
reactome:6798652 2-amino-3-oxobutanoate
2A-3OBU
L-2-amino-3-oxobutanoate
sabiork:6672 (S)-2-Amino-3-oxobutanoic acid
L-2-Amino-3-oxobutanoate
L-2-Amino-acetoacetate
seed:cpd02211 (S)-2-Amino-3-oxobutanoic acid
2aobut
L-2-Amino-3-oxobutanoate
L-2-Amino-3-oxobutanoic acid
L-2-Amino-acetoacetate
deprecated:MNXM815