Feedback

 

trans-aconitate

Image of MNXM1388
Properties
MNX_IDMNXM1388
formulaC6H3O6
charge-3
mass171.0861
referencechebi:15708
InChIKeyGTZCVFVGUGFEME-HNQUOIGGSA-K
InChIInChI=1S/C6H6O6/c7-4(8)1-3(6(11)12)2-5(9)10/h1H,2H2,(H,7,8)(H,9,10)(H,11,12)/p-3/b3-1+
SMILES[O-]C(=O)C\C(=C/C([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of trans-aconitate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:acon_T Trans-Aconitate
chebi:12869
chebi:12878
chebi:15708
chebi:27069
chebi:46108
(1E)-prop-1-ene-1,2,3-tricarboxylate
ACONITATE ION
GTZCVFVGUGFEME-HNQUOIGGSA-K
trans-aconitate
trans-aconitate(3-)
chebi:22210 GTZCVFVGUGFEME-UHFFFAOYSA-K
aconitate(3-)
prop-1-ene-1,2,3-tricarboxylate
chebi:22211 1-propene-1,2,3-tricarboxylic acid
3-carboxy-2-pentenedioic acid
GTZCVFVGUGFEME-UHFFFAOYSA-N
achilleic acid
aconitic acid
citridic acid
equisetic acid
prop-1-ene-1,2,3-tricarboxylic acid
chebi:10719
chebi:27070
chebi:32806
(1E)-1-propene-1,2,3-tricarboxylic acid
(1E)-prop-1-ene-1,2,3-tricarboxylic acid
(E)-1-propene-1,2,3-tricarboxylic acid
GTZCVFVGUGFEME-HNQUOIGGSA-N
trans-Aconitic acid
trans-aconitic acid
hmdb:HMDB00958 (1E)-prop-1-ene-1,2,3-tricarboxylic acid
trans-Aconitic acid
trans-aconitic acid
metacyc:CPD-225 (E)-prop-1-ene-1,2,3-tricarboxylate
CPD-225
trans-aconitate
trans-aconitic acid
kegg:C02341
sabiork:6151
trans-Aconitate
trans-Aconitic acid
seed:cpd01563 acon-T
trans-Aconitate
trans-Aconitic acid
deprecated:MNXM151789