Feedback

 

AMP

Image of MNXM14
Properties
MNX_IDMNXM14
formulaC10H12N5O7P
charge-2
mass345.2064
referencechebi:456215
InChIKeyUDMBCSSLTHHNCD-KQYNXXCUSA-L
InChIInChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/p-2/t4-,6-,7-,10-/m1/s1
SMILESNc1ncnc2n(cnc12)[C@@H]1O[C@H](COP([O-])([O-])=O)[C@@H](O)[C@H]1O

This chemical compound does not exist in my selection



Occurrences of AMP in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:12056
chebi:13234
chebi:13235
chebi:13736
chebi:13740
chebi:16027
chebi:22242
chebi:22245
chebi:2356
chebi:40510
chebi:40726
chebi:40786
chebi:40826
chebi:47222
5'-AMP
5'-Adenosine monophosphate
5'-Adenylic acid
5'-O-phosphonoadenosine
5'-adenylic acid
ADENOSINE MONOPHOSPHATE
AMP
Adenosine 5'-monophosphate
Adenosine 5'-phosphate
Adenosine-5'-monophosphoric acid
Adenylate
Adenylic acid
Ado5'P
PAdo
UDMBCSSLTHHNCD-KQYNXXCUSA-N
adenosine 5'-(dihydrogen phosphate)
adenosine phosphate
adenosine-5'P
adenosini phosphas
fosfato de adenosina
pA
phosphate d'adenosine
chebi:40721 AMP(1+)
N1-PROTONATED ADENOSINE-5'-MONOPHOSPHATE
UDMBCSSLTHHNCD-KQYNXXCUSA-O
chebi:456215 5'-O-phosphonatoadenosine
AMP
AMP dianion
AMP(2-)
Adenosine-5-monophosphate dianion
Adenosine-5-monophosphate(2-)
UDMBCSSLTHHNCD-KQYNXXCUSA-L
kegg:C00020
kegg:D02769
5'-AMP
5'-Adenosine monophosphate
5'-Adenylic acid
AMP
Adenosine 5'-monophosphate
Adenosine 5'-phosphate
Adenosine phosphate (USAN/INN)
Adenyl (TN)
Adenylate
Adenylic acid
metacyc:AMP 5'-AMP
5'-adenosine monophosphate
5'-adenylic acid
AMP
adenosine 5'-monophosphate
adenosine 5'-phosphate
adenosine-monophosphate
adenylate
adenylic acid
metacyc:AMP-GROUP AMP group
AMP-GROUP
adenosine 5'-phosphate group
reactome:109275 AMP
adenosine 5'-monophosphate
adenylic acid
bigg:amp
reactome:164121
AMP
reactome:389620 AMP
adenosine 5'-monophosphate
reactome:159448
reactome:76577
5'-AMP
5'-Adenosine monophosphate
5'-Adenylic acid
AMP
Adenosine 5'-phosphate
Adenylate
Adenylic acid
adenosine 5'-monophosphate
sabiork:1273 5'-AMP
5'-Adenosine monophosphate
5'-Adenylic acid
AMP
Adenosine 5'-monophosphate
Adenosine 5'-phosphate
Adenylate
Adenylic acid
seed:cpd00018 5'-AMP
5'-Adenosine monophosphate
5'-Adenylic acid
AMP
Adenosine 5'-monophosphate
Adenosine 5'-phosphate
Adenylate
Adenylic acid
amp
seed:cpd22272 AMP group
O-adenosine-5'-phosphate
deprecated:MNXM114098
deprecated:MNXM41961
deprecated:MNXM89573
deprecated:MNXM96410