My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

3-(4-hydroxyphenyl)pyruvate

Image of MNXM153
Properties
MNX_IDMNXM153
formulaC9H7O4
charge-1
mass179.15
referencechebi:36242
InChIKeyKKADPXVIOXHVKN-UHFFFAOYSA-M
InChIInChI=1S/C9H8O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,10H,5H2,(H,12,13)/p-1
SMILESOc1ccc(CC(=O)C([O-])=O)cc1

This chemical compound does not exist in my selection



Occurrences of 3-(4-hydroxyphenyl)pyruvate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:2h34hppr 2-Hydroxy-3-(4-hydroxyphenyl)propenoate
bigg:34hpp 3-(4-Hydroxyphenyl)pyruvate
chebi:11725
chebi:11727
chebi:12016
chebi:20425
chebi:36242
chebi:594665
3-(4-Hydroxyphenyl)pyruvate
3-(4-hydroxyphenyl)-2-oxopropanoate
3-(4-hydroxyphenyl)pyruvate
3-(p-hydroxyphenyl)pyruvate
4-Hydroxyphenylpyruvate
HPP
KKADPXVIOXHVKN-UHFFFAOYSA-M
p-hydroxyphenylpyruvate
chebi:1431
chebi:15999
chebi:20426
chebi:42422
(4-hydroxyphenyl)pyruvic acid
(p-hydroxyphenyl)pyruvic acid
3-(4-HYDROXY-PHENYL)PYRUVIC ACID
3-(4-hydroxyphenyl)-2-oxopropanoic acid
3-(4-hydroxyphenyl)pyruvic acid
3-(p-hydroxyphenyl)-2-oxopropanoic acid
4-hydroxy alpha-oxobenzenepropanoic acid
4-hydroxyphenylpyruvic acid
KKADPXVIOXHVKN-UHFFFAOYSA-N
p-Hydroxyphenylpyruvic acid
chebi:1118
chebi:19599
chebi:27683
2-hydroxy-3-(4-hydroxyphenyl)acrylic acid
2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid
2-hydroxy-3-(4-hydroxyphenyl)propenoic acid
4,alpha-dihydroxycinnamic acid
GQYBCIHRWMPOOF-YVMONPNESA-N
envipath:...db7737caa79b 4-Hydroxyphenylpyruvate
hmdb:HMDB00707 3-(4-hydroxyphenyl)-2-oxopropanoic acid
4-Hydroxyphenylpyruvic acid
4-hydroxyphenylpyruvic acid
hmdb:HMDB06915 (2Z)-2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid
2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid
4,alpha-dihydroxycinnamic acid
kegg:C01179
sabiork:5423
3-(4-Hydroxyphenyl)pyruvate
4-Hydroxyphenylpyruvate
p-Hydroxyphenylpyruvic acid
kegg:C05350
sabiork:2779
seed:cpd03174
2-Hydroxy-3-(4-hydroxyphenyl)propenoate
4-Hydroxy-enol-phenylpyruvate
metacyc:P-HYDROXY-PHENYLPYRUVATE 3-(4-hydroxyphenyl)pyruvate
4-hydroxyphenylpyruvate
P-HYDROXY-PHENYLPYRUVATE
hydroxyphenylpyruvate
p-hydroxyphenylpyruvate
p-hydroxyphenylpyruvic acid
reactome:31365 (4-hydroxyphenyl)pyruvic acid
3-(4-Hydroxyphenyl)pyruvate
4-Hydroxyphenylpyruvate
HPPYRA
p-Hydroxyphenylpyruvic acid
seed:cpd00868 3-(4-Hydroxyphenyl)pyruvate
3--4-Hydroxyphenylpyruvate
34hpp
4-Hydroxyphenylpyruvate
p-Hydroxyphenylpyruvic acid
p-hydroxyphenylpyruvate
deprecated:MNXM114441
deprecated:MNXM145630
deprecated:MNXM89732
deprecated:MNXM92977