My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

2-oxobutanoate

Image of MNXM159
Properties
MNX_IDMNXM159
formulaC4H5O3
charge-1
mass101.0812
referencechebi:16763
InChIKeyTYEYBOSBBBHJIV-UHFFFAOYSA-M
InChIInChI=1S/C4H6O3/c1-2-3(5)4(6)7/h2H2,1H3,(H,6,7)/p-1
SMILESCCC(=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 2-oxobutanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:11636
chebi:16763
chebi:19741
2-Ketobutanoate
2-Oxobutyrate
2-ketobutyrate
2-oxobutanoate
TYEYBOSBBBHJIV-UHFFFAOYSA-M
alpha-ketobutyrate
alpha-oxobutyrate
chebi:1250
chebi:19743
chebi:30831
chebi:39748
2-KETOBUTYRIC ACID
2-Ketobutanoic acid
2-Ketobutyric acid
2-Oxobutanoic acid
2-Oxobutyric acid
2-oxobutanoic acid
3-methyl pyruvic acid
TYEYBOSBBBHJIV-UHFFFAOYSA-N
alpha-Ketobutyrate
alpha-Ketobutyric acid
alpha-ketobutyric acid
alpha-oxo-n-butyric acid
bigg:2obut
envipath:...3b00be5e4e8b
2-Oxobutanoate
envipath:...253fcbde268f compound 38030
kegg:C00109 2-Ketobutyric acid
2-Oxobutanoate
2-Oxobutanoic acid
2-Oxobutyrate
2-Oxobutyric acid
alpha-Ketobutyrate
alpha-Ketobutyric acid
lipidmaps:LMFA01060002 2-oxo-butanoic acid
3-methyl pyruvic acid
lipidmaps:LMFA01060002
metacyc:2-OXOBUTANOATE 2-OXOBUTANOATE
2-keto-butyrate
2-ketobutyrate
2-ketobutyric acid
2-oxo-butyrate
2-oxobutanoate
2-oxobutyrate
2-oxobutyric acid
a-ketobutyric acid
alpha-ketobutyrate
alpha-ketobutyric acid
alpha-oxobutyric acid
reactome:936714 2-Ketobutyrate
2-oxobutanoate
2-oxobutanoic acid
2OBUTA
sabiork:1934 2-Ketobutyrate
2-Ketobutyric acid
2-Oxobutanoate
2-Oxobutanoic acid
2-Oxobutyrate
2-Oxobutyric acid
alpha-Ketobutyrate
alpha-Oxobutyrate
seed:cpd00094 2-Ketobutyric acid
2-Oxobutanoate
2-Oxobutanoic acid
2-Oxobutyrate
2-Oxobutyric acid
2obut
alpha-Ketobutyrate
alpha-Ketobutyric acid
deprecated:MNXM89845