Feedback

 

(2S)-2-isopropyl-3-oxosuccinate

Image of MNXM1602
Properties
MNX_IDMNXM1602
formulaC7H8O5
charge-2
mass172.1365
referencechebi:17214
InChIKeyHIIZAGQWABAMRR-BYPYZUCNSA-L
InChIInChI=1S/C7H10O5/c1-3(2)4(6(9)10)5(8)7(11)12/h3-4H,1-2H3,(H,9,10)(H,11,12)/p-2/t4-/m0/s1
SMILESCC(C)[C@H](C([O-])=O)C(=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (2S)-2-isopropyl-3-oxosuccinate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3c4mop 3-Carboxy-4-methyl-2-oxopentanoate
chebi:1467 (2S)-2-(1-methylethyl)-3-oxobutanedioic acid
(2S)-2-Isopropyl-3-oxosuccinate
(2S)-2-isopropyl-3-oxosuccinic acid
(2S)-3-oxo-2-(propan-2-yl)butanedioic acid
3-Carboxy-4-methyl-2-oxopentanoate
HIIZAGQWABAMRR-BYPYZUCNSA-N
chebi:11765
chebi:17214
chebi:19975
(2S)-2-isopropyl-3-oxosuccinate
(2S)-2-isopropyl-3-oxosuccinate(2-)
(2S)-3-oxo-2-(propan-2-yl)butanedioate
HIIZAGQWABAMRR-BYPYZUCNSA-L
hmdb:HMDB12149 (2S)-2-isopropyl-3-oxobutanedioic acid
(3S)-2-oxo-3-(propan-2-yl)butanedioic acid
2-Isopropyl-3-oxosuccinate
kegg:C04236 (2S)-2-Isopropyl-3-oxosuccinate
2-Oxo-4-methyl-3-carboxypentanoate
3-Carboxy-4-methyl-2-oxopentanoate
metacyc:CPD-7100 (2S)-2-isopropyl-3-oxosuccinate
2-isopropyl-3-oxosuccinate
CPD-7100
seed:cpd02605 (2S)-2-Isopropyl-3-oxosuccinate
2-Oxo-4-methyl-3-carboxypentanoate
2-isopropyl-3-oxosuccinate
3-Carboxy-4-methyl-2-oxopentanoate
3c4mop