My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

4-hydroxybenzoate

Image of MNXM164
Properties
MNX_IDMNXM164
formulaC7H5O3
charge-1
mass137.1133
referencechebi:17879
InChIKeyFJKROLUGYXJWQN-UHFFFAOYSA-M
InChIInChI=1S/C7H6O3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H,(H,9,10)/p-1
SMILESOc1ccc(cc1)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 4-hydroxybenzoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:4hbz
envipath:...785c0dc04bfa
4-Hydroxybenzoate
chebi:12003
chebi:17879
chebi:20397
4-hydroxybenzoate
4-hydroxybenzoic acid, ion(1-)
FJKROLUGYXJWQN-UHFFFAOYSA-M
p-hydroxybenzoate
chebi:1858
chebi:20398
chebi:30763
chebi:44949
4-Hydroxybenzoic acid
4-carboxyphenol
4-hydroxybenzoic acid
FJKROLUGYXJWQN-UHFFFAOYSA-N
P-HYDROXYBENZOIC ACID
p-hydroxybenzoic acid
p-salicylic acid
envipath:...c660b8587741 compound 131
envipath:...049369c47662 compound 37913
hmdb:HMDB00500 4-Hydroxybenzoic acid
4-hydroxybenzoic acid
P-hydroxybenzoic acid
metacyc:4-hydroxybenzoate 4-hydroxybenzoate
p-hydroxybenzoate
reactome:2162213 4-hydroxybenzoic acid
PHB
kegg:C00156
sabiork:1951
4-Hydroxybenzoate
4-Hydroxybenzoic acid
Hydroxybenzenecarboxylic acid
Hydroxybenzoic acid
seed:cpd00136 4-Hydroxybenzoate
4-Hydroxybenzoic acid
4hbz
Hydroxybenzenecarboxylic acid
Hydroxybenzoic acid