My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

(S)-lactate

Image of MNXM179
Properties
MNX_IDMNXM179
formulaC3H5O3
charge-1
mass89.0705
referencechebi:16651
InChIKeyJVTAAEKCZFNVCJ-REOHCLBHSA-M
InChIInChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/p-1/t2-/m0/s1
SMILESC[C@H](O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (S)-lactate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:lac__L L-Lactate
chebi:11065
chebi:12411
chebi:16651
chebi:18783
(+)-lactate
(2S)-2-hydroxypropanoate
(S)-lactate
JVTAAEKCZFNVCJ-REOHCLBHSA-M
L(+)-lactate
L-(+)-lactate
L-lactate
chebi:422 (+)-lactic acid
(2S)-2-hydroxypropanoic acid
(S)-(+)-lactic acid
(S)-2-hydroxypropanoic acid
(S)-2-hydroxypropionic acid
(S)-lactic acid
JVTAAEKCZFNVCJ-REOHCLBHSA-N
L-(+)-alpha-hydroxypropionic acid
L-(+)-lactic acid
L-Lactic acid
L-Milchsaeure
hmdb:HMDB00190
hmdb:HMDB03328
(2S)-2-hydroxypropanoic acid
(alpha)-lactate
L-Lactic acid
hmdb:HMDB62492 (2S)-2-hydroxypropanoate
L-(+)-lactate
L-Lactate
kegg:C00186
sabiork:1312
(S)-Lactate
L-Lactate
L-Lactic acid
metacyc:L-LACTATE (S)-lactate
L(+)-lactate
L-LACTATE
L-lactate
reactome:29708
reactome:373863
reactome:6807616
(S)-Lactate
(S)-lactic acid
L-Lactate
L-Lactic acid
LACT
seed:cpd00159 (S)-Lactate
L-Lactate
L-Lactic acid
LCTT
lac-L
deprecated:MNXM89690