My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

D-glycerate

Image of MNXM189
Properties
MNX_IDMNXM189
formulaC3H5O4
charge-1
mass105.0699
referencechebi:16659
InChIKeyRBNPOMFGQQGHHO-UWTATZPHSA-M
InChIInChI=1S/C3H6O4/c4-1-2(5)3(6)7/h2,4-5H,1H2,(H,6,7)/p-1/t2-/m1/s1
SMILESOC[C@@H](O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of D-glycerate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:glyc__R (R)-Glycerate
chebi:10999
chebi:12985
chebi:16659
chebi:21027
(2R)-2,3-dihydroxypropanoate
(R)-glycerate
(R)-glycerate anion
D-glycerate
RBNPOMFGQQGHHO-UWTATZPHSA-M
alpha,beta-Hydroxypropionate
chebi:21030
chebi:32398
chebi:4187
chebi:41990
(2R)-2,3-dihydroxypropanoic acid
D-Glyceric acid
D-GroA
D-glyceric acid
Glyceric acid
R-glyceric acid
RBNPOMFGQQGHHO-UWTATZPHSA-N
alpha,beta-Hydroxypropionic acid
chebi:24348
chebi:24349
chebi:33508
chebi:33846
2,3-dihydroxypropanoic acid
2,3-dihydroxypropionic acid
Gro
RBNPOMFGQQGHHO-UHFFFAOYSA-N
glyceric acid
chebi:33871 RBNPOMFGQQGHHO-UHFFFAOYSA-M
glycerate
envipath:...26231b127f45 compound 1705
envipath:...d4d843d29da0 compound 37984
hmdb:HMDB00139 (2R)-2,3-dihydroxypropanoic acid
Glyceric acid
glycerate
kegg:C00258 (R)-Glycerate
D-Glycerate
Glycerate
Glyceric acid
metacyc:GLYCERATE (R)-glycerate
D-glycerate
D-glyceric acid
GLYCERATE
glycerate
reactome:6799497 D-glyceric acid
DGA
sabiork:1999 (R)-Glycerate
D-Glycerate
sabiork:3917 Glycerate
Glyceric acid
seed:cpd00223 (R)-Glycerate
D-Glycerate
Glycerate
Glyceric acid
glyc-R