My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

2-oxoglutarate

Image of MNXM20
Properties
MNX_IDMNXM20
formulaC5H4O5
charge-2
mass144.0834
referencechebi:16810
InChIKeyKPGXRSRHYNQIFN-UHFFFAOYSA-L
InChIInChI=1S/C5H6O5/c6-3(5(9)10)1-2-4(7)8/h1-2H2,(H,7,8)(H,9,10)/p-2
SMILES[O-]C(=O)CCC(=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 2-oxoglutarate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:11638
chebi:16810
chebi:19748
2-ketoglutarate
2-oxoglutarate
2-oxoglutarate(2-)
2-oxopentanedioate
2-oxopentanedioic acid, ion(2-)
KPGXRSRHYNQIFN-UHFFFAOYSA-L
alpha-ketoglutarate
chebi:1253
chebi:19749
chebi:30915
chebi:40661
2-Ketoglutaric acid
2-oxoglutaric acid
2-oxopentanedioic acid
KPGXRSRHYNQIFN-UHFFFAOYSA-N
Oxoglutaric acid
alpha-Ketoglutaric acid
alpha-ketoglutaric acid
chebi:30916 2-ketoglutarate
2-oxoglutarate(1-)
4-carboxy-2-oxobutanoate
KPGXRSRHYNQIFN-UHFFFAOYSA-M
bigg:akg
envipath:...fb79b4e697f5
2-Oxoglutarate
envipath:...8ce0eae788a9 compound 974
hmdb:HMDB62781 2-oxoglutarate(2-)
2-oxopentanedioate
alpha ketoglutarate
kegg:C00026 2-Ketoglutaric acid
2-Oxoglutarate
Oxoglutaric acid
alpha-Ketoglutaric acid
metacyc:2-KETOGLUTARATE 2-KETOGLUTARATE
2-ketoglutarate
2-ketoglutaric acid
2-oxoglutarate
2-oxoglutaric acid
2-oxopentanedionate
2-oxopentanedionic acid
a-ketoglutaric acid
alpha-ketoglutarate
alpha-ketoglutaric acid
alpha-oxoglutarate
ketoglutarate
metacyc:CPD-16852 (2Z)-2-hydroxypent-2-enedioate
CPD-16852
reactome:113594
reactome:389537
reactome:561075
2-Ketoglutaric acid
2-Oxoglutarate
2-oxoglutaric acid
2OG
Oxoglutaric acid
alpha-Ketoglutaric acid
reactome:113671 2-Oxoglutarate
2-oxoglutaric acid
2OG
alpha-ketoglutarate
reactome:29406 2-Ketoglutaric acid
2-Oxoglutarate
2-oxoglutarate
2-oxoglutaric acid
2OG
Oxoglutaric acid
alpha-Ketoglutaric acid
alpha-ketoglutarate
reactome:5278317 2-oxoglutarate
2-oxoglutarate(2-)
2OG
phys-ent-participant104038
phys-ent-participant104066
phys-ent-participant104452
phys-ent-participant106020
phys-ent-participant109495
phys-ent-participant10994
phys-ent-participant110137
phys-ent-participant12897
phys-ent-participant15589
phys-ent-participant15890
phys-ent-participant16630
phys-ent-participant16699
phys-ent-participant16729
phys-ent-participant18115
phys-ent-participant24030
phys-ent-participant24144
phys-ent-participant24197
phys-ent-participant24212
phys-ent-participant25065
phys-ent-participant26991
phys-ent-participant28794
phys-ent-participant33434
phys-ent-participant34484
phys-ent-participant34508
phys-ent-participant37017
phys-ent-participant37075
phys-ent-participant37797
phys-ent-participant37814
phys-ent-participant38404
phys-ent-participant38445
phys-ent-participant38552
phys-ent-participant38853
phys-ent-participant38884
phys-ent-participant38894
phys-ent-participant4516
phys-ent-participant45596
phys-ent-participant47131
phys-ent-participant47185
phys-ent-participant50363
phys-ent-participant50655
phys-ent-participant51911
phys-ent-participant5407
phys-ent-participant5432
phys-ent-participant56418
phys-ent-participant57035
phys-ent-participant57097
phys-ent-participant58229
phys-ent-participant58252
phys-ent-participant58270
phys-ent-participant58357
phys-ent-participant58706
phys-ent-participant58756
phys-ent-participant6217
phys-ent-participant64112
phys-ent-participant69325
phys-ent-participant69370
phys-ent-participant69436
phys-ent-participant7253
phys-ent-participant76859
phys-ent-participant76894
phys-ent-participant77323
phys-ent-participant77403
phys-ent-participant77442
phys-ent-participant77471
phys-ent-participant77497
phys-ent-participant77523
phys-ent-participant77561
phys-ent-participant77587
phys-ent-participant77804
phys-ent-participant78818
phys-ent-participant81027
phys-ent-participant82158
phys-ent-participant82384
phys-ent-participant83136
phys-ent-participant87149
phys-ent-participant87431
phys-ent-participant88435
phys-ent-participant88507
phys-ent-participant88591
phys-ent-participant88875
phys-ent-participant89233
phys-ent-participant89242
phys-ent-participant89311
phys-ent-participant89591
phys-ent-participant89777
phys-ent-participant89793
phys-ent-participant89808
phys-ent-participant90008
phys-ent-participant90988
phys-ent-participant91023
phys-ent-participant91031
phys-ent-participant91044
phys-ent-participant91060
phys-ent-participant91074
phys-ent-participant91493
phys-ent-participant92427
phys-ent-participant95965
phys-ent-participant97717
phys-ent-participant97738
phys-ent-participant9880
phys-ent-participant99135
phys-ent-participant99262
phys-ent-participant99366
phys-ent-participant99434
sabiork:1922 2-Ketoglutarate
2-Ketoglutaric acid
2-Oxoglutarate
Oxoglutaric acid
alpha-Ketoglutarate
alpha-Ketoglutaric acid
seed:cpd00024 2-Ketoglutaric acid
2-Oxoglutarate
Oxoglutaric acid
akg
alpha-Ketoglutaric acid
deprecated:MNXM89569