My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

enol-phenylpyruvate

Image of MNXM210
Properties
MNX_IDMNXM210
formulaC9H7O3
charge-1
mass163.1506
referencechebi:16815
InChIKeyBTNMPGBKDVTSJY-UHFFFAOYSA-M
InChIInChI=1S/C9H8O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12)/p-1
SMILES[O-]C(=O)C(=O)Cc1ccccc1

This chemical compound does not exist in my selection



Occurrences of enol-phenylpyruvate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:phpyr Phenylpyruvate
chebi:12811
chebi:16815
chebi:23912
2-Hydroxy-3-phenylpropenoate
2-hydroxy-3-phenylacrylate
2-hydroxy-3-phenylprop-2-enoate
DEDGUGJNLNLJSR-UHFFFAOYSA-M
enol-Phenylpyruvate
enol-phenylpyruvate
chebi:10548
chebi:23914
chebi:23915
chebi:32815
2-hydroxy-3-phenylacrylic acid
2-hydroxy-3-phenylprop-2-enoic acid
DEDGUGJNLNLJSR-UHFFFAOYSA-N
enol-Phenylpyruvate
enol-Phenylpyruvic acid
enol-alpha-Ketohydrocinnamic acid
enol-phenylpyruvic acid
chebi:26009
chebi:30851
chebi:45005
chebi:8105
2-oxo-3-phenylpropanoic acid
3-PHENYLPYRUVIC ACID
3-Phenyl-2-oxopropanoate
3-phenyl-2-oxopropanoic acid
3-phenylpyruvic acid
BTNMPGBKDVTSJY-UHFFFAOYSA-N
Phenylbrenztraubensaeure
Phenylpyruvate
Phenylpyruvic acid
alpha-Ketohydrocinnamic acid
alpha-oxo-benzenepropanoic acid
beta-phenylpyruvic acid
keto-Phenylpyruvate
keto-phenylpyruvic acid
envipath:...759953ea5e07 compound 42522
hmdb:HMDB12225 (2Z)-2-hydroxy-3-phenylprop-2-enoic acid
DL-alpha-hydroxycinnamic acid
Enol-phenylpyruvate
kegg:C00166 2-Oxo-3-phenylpropanoate
3-Phenyl-2-oxopropanoate
Phenylpyruvate
Phenylpyruvic acid
alpha-Ketohydrocinnamic acid
keto-Phenylpyruvate
metacyc:ENOL-PHENYLPYRUVATE ENOL-PHENYLPYRUVATE
enol-phenylpyruvate
metacyc:PHENYL-PYRUVATE 2-oxo-3-phenylpropanoate
3-phenyl-2-oxopropanoate
3-phenylpyruvate
3-phenylpyruvic acid
PHENYL-PYRUVATE
alpha-ketohydrocinnamic acid
phenylpyruvate
reactome:2160466 kPPV
keto-phenylpyruvate
sabiork:1957 3-Phenyl-2-oxopropanoate
Keto-Phenylpyruvate
Phenylpyruvate
Phenylpyruvic acid
alpha-Ketohydrocinnamic acid
keto-Phenylpyruvate
sabiork:2520 2-Hydroxy-3-phenylpropenoate
Enol-Phenylpyruvate
Enol-Phenylpyruvic acid
Enol-alpha-Ketohydrocinnamic acid
enol-Phenylpyruvic acid
enol-alpha-Ketohydrocinnamic acid
seed:cpd00143 3-Phenyl-2-oxopropanoate
Phenylpyruvate
Phenylpyruvic acid
alpha-Ketohydrocinnamic acid
keto-Phenylpyruvate
phpyr
kegg:C02763
seed:cpd01784
2-Hydroxy-3-phenylpropenoate
enol-Phenylpyruvate
enol-Phenylpyruvic acid
enol-alpha-Ketohydrocinnamic acid
deprecated:MNXM93385