My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

benzoate

Image of MNXM217
Properties
MNX_IDMNXM217
formulaC7H5O2
charge-1
mass121.1139
referencechebi:16150
InChIKeyWPYMKLBDIGXBTP-UHFFFAOYSA-M
InChIInChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/p-1
SMILES[O-]C(=O)c1ccccc1

This chemical compound does not exist in my selection



Occurrences of benzoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:bz
envipath:...63ac4d9d4d4f
Benzoate
chebi:13879
chebi:16150
chebi:22717
Benzenecarboxylate
Benzeneformate
Benzenemethanoate
Phenylcarboxylate
Phenylformate
WPYMKLBDIGXBTP-UHFFFAOYSA-M
benzoate
benzoate anion
benzoic acid, ion(1-)
chebi:22722
chebi:3029
chebi:30746
chebi:41051
Aromatic carboxylic acid
BENZOIC ACID
Benzenecarboxylic acid
Benzeneformic acid
Benzenemethanoic acid
Benzoesaeure
Benzoic acid
Dracylic acid
E210
Phenylcarboxylic acid
Phenylformic acid
WPYMKLBDIGXBTP-UHFFFAOYSA-N
acide benzoique
benzoic acid
envipath:...d98fd864baf2 compound 126
envipath:...fcfde47d1d15 compound 37916
hmdb:HMDB01870 Benzoic acid
benzoic acid
kegg:C00539 Aromatic acid
Aromatic carboxylic acid
kegg:C00180
kegg:D00038
Benzenecarboxylic acid
Benzoate
Benzoic acid
Benzoic acid (JP17/USP)
Benzoic acid (TN)
Dracylic acid
Phenylformic acid
metacyc:BENZOATE BENZOATE
benzenecarboxylic acid
benzoate
benzoic acid
phenylformic acid
reactome:159446 BENZA
Benzoate
benzoic acid
sabiork:1912 Benzenecarboxylic acid
Benzoate
Benzoic acid
Dracylic acid
Phenyl formate
Phenylformic acid
seed:cpd00153 Benzenecarboxylic acid
Benzoate
Benzoic acid
Dracylic acid
Phenylformic acid
bz
deprecated:MNXM90451