My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

orotate

Image of MNXM235
Properties
MNX_IDMNXM235
formulaC5H3N2O4
charge-1
mass155.0889
referencechebi:30839
InChIKeyPXQPEWDEAKTCGB-UHFFFAOYSA-M
InChIInChI=1S/C5H4N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11)/p-1
SMILES[O-]C(=O)c1cc(=O)[nH]c(=O)[nH]1

This chemical compound does not exist in my selection



Occurrences of orotate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:orot Orotate
chebi:14698
chebi:25719
chebi:30839
2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate
PXQPEWDEAKTCGB-UHFFFAOYSA-M
orotate
chebi:16742
chebi:25720
chebi:44781
chebi:7787
2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid
OROTIC ACID
Orotic acid
Orotsaeure
PXQPEWDEAKTCGB-UHFFFAOYSA-N
Uracil-6-carboxylic acid
orotic acid
hmdb:HMDB00226 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid
Orotic acid
orotic acid
kegg:C00295
kegg:D00055
Orotate
Orotic acid
Orotic acid (JAN)
Uracil-6-carboxylic acid
metacyc:OROTATE OROTATE
orotate
orotic acid
reactome:76632 orotate
orotic acid
uracil-6-carboxylic acid
sabiork:2009 Orotate
Orotic acid
Uracil-6-carboxylic acid
seed:cpd00247 Orotate
Orotic acid
Uracil-6-carboxylic acid
orot
deprecated:MNXM89788