My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

3-methyl-2-oxobutanoate

Image of MNXM238
Properties
MNX_IDMNXM238
formulaC5H7O3
charge-1
mass115.1078
referencechebi:11851
InChIKeyQHKABHOOEWYVLI-UHFFFAOYSA-M
InChIInChI=1S/C5H8O3/c1-3(2)4(6)5(7)8/h3H,1-2H3,(H,7,8)/p-1
SMILESCC(C)C(=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 3-methyl-2-oxobutanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3mob 3-Methyl-2-oxobutanoate
chebi:11851 2-Oxo-3-methylbutanoate
2-Oxoisopentanoate
2-Oxoisovalerate
3-methyl-2-oxobutanoate
3-methyl-2-oxobutyrate
QHKABHOOEWYVLI-UHFFFAOYSA-M
alpha-keto-isovalerate
chebi:132177 2-hydroxy-3-methyl-2-butenoic acid
2-hydroxy-3-methylbut-2-enoic acid
YXHQZJPTLDUABH-UHFFFAOYSA-N
chebi:1584
chebi:16530
chebi:20115
chebi:43714
2-Keto-3-methylbutyric acid
2-Ketoisovaleric acid
2-Ketovaline
2-Oxo-3-methylbutanoic acid
2-Oxo-3-methylbutyric acid
2-Oxoisovaleric acid
3-METHYL-2-OXOBUTANOIC ACID
3-Methyl-2-oxobutanoate
3-Methyl-2-oxobutanoic acid
3-Methyl-2-oxobutyric acid
3-methyl-2-oxobutanoic acid
Dimethylpyruvic acid
Isopropylglyoxylic acid
QHKABHOOEWYVLI-UHFFFAOYSA-N
alpha-Ketovaline
alpha-keto-isovaleric acid
alpha-oxo-beta-methylbutyricacid
alpha-oxoisovaleric acid
envipath:...fa61f1f45f03 compound 38785
kegg:C00141 2-Keto-3-methylbutyric acid
2-Ketovaline
2-Oxo-3-methylbutanoate
2-Oxoisopentanoate
2-Oxoisovalerate
3-Methyl-2-oxobutanoate
3-Methyl-2-oxobutanoic acid
3-Methyl-2-oxobutyric acid
alpha-Ketovaline
lipidmaps:LMFA01020274 3-methyl-2-oxo-butanoic acid
lipidmaps:LMFA01020274
metacyc:2-KETO-ISOVALERATE 2-KETO-ISOVALERATE
2-keto-3-methylbutyric acid
2-keto-isovalerate
2-ketovaline
2-oxo-3-methylbutanoate
2-oxoisopentanoate
2-oxoisovalerate
3-methyl-2-oxobutanoate
alpha-keto-isovalerate
alpha-keto-isovaleric acid
alpha-keto-valine
alpha-ketoisopentanoic acid
alpha-ketovaline
alpha-oxoisovalerate
sabiork:1945 2-Keto-3-methylbutyric acid
2-Ketovaline
2-Oxo-3-methylbutanoate
2-Oxoisopentanoate
2-Oxoisovalerate
3-Methyl-2-oxobutanoate
3-Methyl-2-oxobutyric acid
alpha-Ketoisovalerate
alpha-Ketovaline
seed:cpd00123 2-Keto-3-methylbutyric acid
2-Ketovaline
2-Oxo-3-methylbutanoate
2-Oxoisopentanoate
2-Oxoisovalerate
2-keto-isovalerate
3-Methyl-2-oxobutanoate
3-Methyl-2-oxobutanoic acid
3-Methyl-2-oxobutyric acid
3MOB
3mob
alpha-Ketovaline