My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

3',5'-cyclic AMP

Image of MNXM243
Properties
MNX_IDMNXM243
formulaC10H11N5O6P
charge-1
mass328.1986
referencechebi:58165
InChIKeyIVOMOUWHDPKRLL-KQYNXXCUSA-M
InChIInChI=1S/C10H12N5O6P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(20-10)1-19-22(17,18)21-7/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13)/p-1/t4-,6-,7-,10-/m1/s1
SMILESNc1ncnc2n(cnc12)[C@@H]1O[C@@H]2COP([O-])(=O)O[C@H]2[C@H]1O

This chemical compound does not exist in my selection



Occurrences of 3',5'-cyclic AMP in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:camp CAMP
chebi:11673
chebi:1325
chebi:17489
chebi:19827
chebi:41588
3',5'-Cyclic AMP
3',5'-cyclic AMP
ADENOSINE-3',5'-CYCLIC-MONOPHOSPHATE
Adenosine 3',5'-cyclic phosphate
Adenosine 3',5'-phosphate
Cyclic AMP
Cyclic adenylic acid
IVOMOUWHDPKRLL-KQYNXXCUSA-N
adenosine 3',5'-(hydrogen phosphate)
adenosine 3',5'-cyclic monophosphate
cAMP
chebi:58165 3',5'-cyclic AMP
3',5'-cyclic AMP anion
3',5'-cyclic AMP(1-)
IVOMOUWHDPKRLL-KQYNXXCUSA-M
adenosine 3',5'-cyclic monophosphate
adenosine 3',5'-cyclic monophosphate anion
adenosine 3',5'-cyclic monophosphate(1-)
adenosine 3',5'-phosphate
hmdb:HMDB00058 (4aR,6R,7R,7aS)-6-(6-amino-9H-purin-9-yl)-2,7-dihydroxy-hexahydro-2lambda⁵-furo[3,2-d][1,3,2]dioxaphosphinin-2-one
Cyclic AMP
cyclic adenosine monophosphate
kegg:C00575 3',5'-Cyclic AMP
Adenosine 3',5'-cyclic phosphate
Adenosine 3',5'-phosphate
Cyclic AMP
Cyclic adenylic acid
cAMP
metacyc:CAMP 3',5'-cyclic AMP
CAMP
adenosine 3',5'-cyclic phosphate
adenosine cyclic-3',5'-monophosphate
adenosine cyclic-monophosphate
adenosine-3',5'-cyclic monophosphate
adenosine-3',5'-monophosphate
adenosine-cyclic-phosphate
adenosine-cyclic-phosphoric-acid
cAMP
cyclic 3',5'-AMP
cyclic-3',5'-adenosine monophosphate
cyclic-AMP
reactome:30389 3',5'-cyclic AMP
Adenosine 3',5'-phosphate
Cyclic AMP
Cyclic adenylic acid
cAMP
sabiork:1379 3',5'-Cyclic AMP
Adenosine 3',5'-phosphate
Cyclic AMP
Cyclic adenylic acid
cAMP
seed:cpd00446 3',5'-Cyclic AMP
Adenosine 3',5'-phosphate
Cyclic AMP
Cyclic adenylic acid
cAMP
camp
deprecated:MNXM89622