Feedback

 

dTMP

Image of MNXM257
Properties
MNX_IDMNXM257
formulaC10H13N2O8P
charge-2
mass320.1937
referencechebi:63528
InChIKeyGYOZYWVXFNDGLU-XLPZGREQSA-L
InChIInChI=1S/C10H15N2O8P/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(20-8)4-19-21(16,17)18/h3,6-8,13H,2,4H2,1H3,(H,11,14,15)(H2,16,17,18)/p-2/t6-,7+,8+/m0/s1
SMILESCc1cn([C@H]2C[C@H](O)[C@@H](COP([O-])([O-])=O)O2)c(=O)[nH]c1=O

This chemical compound does not exist in my selection



Occurrences of dTMP in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:dtmp DTMP
chebi:10529
chebi:14092
chebi:15246
chebi:17013
chebi:45759
chebi:45762
chebi:45772
chebi:45926
chebi:46013
chebi:46036
chebi:47711
chebi:63549
(dT)1
2'-deoxy-5-methyluridine 5'-(dihydrogen phosphate)
5'-TMP
5'-Thymidylic acid
5'-thymidylic acid
5-methyl-dUMP
GYOZYWVXFNDGLU-XLPZGREQSA-N
THYMIDINE-5'-PHOSPHATE
TMP
Thymidine 5'-phosphate
Thymidine monophosphate
Thymidylate
Thymidylic acid
dTMP
deoxyribosylthymine monophosphate
ribothymidine 5'-monophosphate
thymidine 5'-(dihydrogen phosphate)
thymidine 5'-phosphoric acid
thymidine-5'-monophosphoric acid
chebi:46960 5'-O-(hydroxyphosphinato)thymidine
GYOZYWVXFNDGLU-XLPZGREQSA-M
dTMP(-)
thymidine 5'-(hydrogen phosphate)
thymidine 5'-phosphate(1-)
chebi:26999
chebi:63528
5'-O-phosphonatothymidine
5-methyl-5'-O-phosphonatouridine
5-methyluridine 5'-phosphate
GYOZYWVXFNDGLU-XLPZGREQSA-L
TMP dianion
dTMP
dTMP(2-)
ribothymidine 5'-monophosphate anion
thymidine 5'-monophosphate
thymidine 5'-phosphate
thymidine 5'-phosphate(2-)
metacyc:TMP 5'-thymidylic acid
TMP
dTMP
deoxythymidine 5'-phosphate
deoxythymidylate
deoxythymidylic acid
thymidine 5'-monophosphate
thymidine 5'-phosphate
thymidine monophosphate
thymidine-phosphate
thymidylate
thymidylic acid
reactome:109366 5'-Thymidylic acid
Deoxythymidine 5'-phosphate
Deoxythymidylic acid
TMP
Thymidine 5'-phosphate
Thymidine monophosphate
Thymidylate
dTMP
thymidine 5'-monophosphate
thymidylic acid
kegg:C00364
sabiork:65
5'-Thymidylic acid
Deoxythymidine 5'-phosphate
Deoxythymidylic acid
Thymidine 5'-phosphate
Thymidine monophosphate
Thymidylate
Thymidylic acid
dTMP
seed:cpd00298 5'-Thymidylic acid
Deoxythymidine 5'-phosphate
Deoxythymidylic acid
Thymidine 5'-phosphate
Thymidine monophosphate
Thymidylate
Thymidylic acid
dTMP
dtmp
deprecated:MNXM87342
deprecated:MNXM90207
deprecated:MNXM96474